About 2-[[3-(piperidin-1-ylmethyl)phenyl]methyl]-1,3-dihydroisoindol-5-ol
2-[[3-(piperidin-1-ylmethyl)phenyl]methyl]-1,3-dihydroisoindol-5-ol (PubChem CID 155953139) has the molecular formula C21H26N2O
and a molecular weight of 322.45 g/mol. Its IUPAC name is 2-[[3-(piperidin-1-ylmethyl)phenyl]methyl]-1,3-dihydroisoindol-5-ol.
Molecular Properties
| Compound Name | 2-[[3-(piperidin-1-ylmethyl)phenyl]methyl]-1,3-dihydroisoindol-5-ol |
| PubChem CID | 155953139 |
| Molecular Formula | C21H26N2O |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | 2-[[3-(piperidin-1-ylmethyl)phenyl]methyl]-1,3-dihydroisoindol-5-ol |
| SMILES | Oc1ccc2c(c1)CN(Cc1cccc(CN3CCCCC3)c1)C2 |
| InChI | InChI=1S/C21H26N2O/c24-21-8-7-19-15-23(16-20(19)12-21)14-18-6-4-5-17(11-18)13-22-9-2-1-3-10-22/h4-8,11-12,24H,1-3,9-10,13-16H2 |
| InChIKey | ORKMCRDOVFXNEW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[[3-(piperidin-1-ylmethyl)phenyl]methyl]-1,3-dihydroisoindol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3-(piperidin-1-ylmethyl)phenyl]methyl]-1,3-dihydroisoindol-5-ol?
The IUPAC name of 2-[[3-(piperidin-1-ylmethyl)phenyl]methyl]-1,3-dihydroisoindol-5-ol (CID 155953139) is 2-[[3-(piperidin-1-ylmethyl)phenyl]methyl]-1,3-dihydroisoindol-5-ol.
What is the SMILES notation for 2-[[3-(piperidin-1-ylmethyl)phenyl]methyl]-1,3-dihydroisoindol-5-ol?
The canonical SMILES for 2-[[3-(piperidin-1-ylmethyl)phenyl]methyl]-1,3-dihydroisoindol-5-ol is Oc1ccc2c(c1)CN(Cc1cccc(CN3CCCCC3)c1)C2.
What is the InChIKey of 2-[[3-(piperidin-1-ylmethyl)phenyl]methyl]-1,3-dihydroisoindol-5-ol?
The InChIKey is ORKMCRDOVFXNEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N2O/c24-21-8-7-19-15-23(16-20(19)12-21)14-18-6-4-5-17(11-18)13-22-9-2-1-3-10-22/h4-8,11-12,24H,1-3,9-10,13-16H2.
What are the key properties of 2-[[3-(piperidin-1-ylmethyl)phenyl]methyl]-1,3-dihydroisoindol-5-ol?
2-[[3-(piperidin-1-ylmethyl)phenyl]methyl]-1,3-dihydroisoindol-5-ol has a molecular weight of 322.45 g/mol, XLogP of 3.89, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3-(piperidin-1-ylmethyl)phenyl]methyl]-1,3-dihydroisoindol-5-ol is sourced from PubChem (CID 155953139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).