C15H19ClFNO2 — CID 155954262
N-[[(3aR,6aR)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]furan-2-yl]methyl]-1-(4-chloro-3-fluorophenyl)ethanamine (PubChem CID 155954262) has the molecular formula C15H19ClFNO2 and a molecular weight of 299.77 g/mol. Its IUPAC name is N-[[(3aR,6aR)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]furan-2-yl]methyl]-1-(4-chloro-3-fluorophenyl)ethanamine.
| Compound Name | N-[[(3aR,6aR)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]furan-2-yl]methyl]-1-(4-chloro-3-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 155954262 |
| Molecular Formula | C15H19ClFNO2 |
| Molecular Weight | 299.77 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | N-[[(3aR,6aR)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]furan-2-yl]methyl]-1-(4-chloro-3-fluorophenyl)ethanamine |
| SMILES | CC(NCC1C[C@@H]2COC[C@@H]2O1)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C15H19ClFNO2/c1-9(10-2-3-13(16)14(17)5-10)18-6-12-4-11-7-19-8-15(11)20-12/h2-3,5,9,11-12,15,18H,4,6-8H2,1H3/t9?,11-,12?,15+/m1/s1 |
| InChIKey | RKCUSTANCRPEBY-HFSBOCFHSA-N |
| XLogP | 2.93 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.77 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |