About 1-amino-3,3-dimethyl-N-(3-pyrazin-2-yloxyphenyl)cyclopentane-1-carboxamide
1-amino-3,3-dimethyl-N-(3-pyrazin-2-yloxyphenyl)cyclopentane-1-carboxamide (PubChem CID 155955394) has the molecular formula C18H22N4O2
and a molecular weight of 326.40 g/mol. Its IUPAC name is 1-amino-3,3-dimethyl-N-(3-pyrazin-2-yloxyphenyl)cyclopentane-1-carboxamide.
Molecular Properties
| Compound Name | 1-amino-3,3-dimethyl-N-(3-pyrazin-2-yloxyphenyl)cyclopentane-1-carboxamide |
| PubChem CID | 155955394 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 1-amino-3,3-dimethyl-N-(3-pyrazin-2-yloxyphenyl)cyclopentane-1-carboxamide |
| SMILES | CC1(C)CCC(N)(C(=O)Nc2cccc(Oc3cnccn3)c2)C1 |
| InChI | InChI=1S/C18H22N4O2/c1-17(2)6-7-18(19,12-17)16(23)22-13-4-3-5-14(10-13)24-15-11-20-8-9-21-15/h3-5,8-11H,6-7,12,19H2,1-2H3,(H,22,23) |
| InChIKey | VVIQNSWWSQYLHW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-amino-3,3-dimethyl-N-(3-pyrazin-2-yloxyphenyl)cyclopentane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3,3-dimethyl-N-(3-pyrazin-2-yloxyphenyl)cyclopentane-1-carboxamide?
The IUPAC name of 1-amino-3,3-dimethyl-N-(3-pyrazin-2-yloxyphenyl)cyclopentane-1-carboxamide (CID 155955394) is 1-amino-3,3-dimethyl-N-(3-pyrazin-2-yloxyphenyl)cyclopentane-1-carboxamide.
What is the SMILES notation for 1-amino-3,3-dimethyl-N-(3-pyrazin-2-yloxyphenyl)cyclopentane-1-carboxamide?
The canonical SMILES for 1-amino-3,3-dimethyl-N-(3-pyrazin-2-yloxyphenyl)cyclopentane-1-carboxamide is CC1(C)CCC(N)(C(=O)Nc2cccc(Oc3cnccn3)c2)C1.
What is the InChIKey of 1-amino-3,3-dimethyl-N-(3-pyrazin-2-yloxyphenyl)cyclopentane-1-carboxamide?
The InChIKey is VVIQNSWWSQYLHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N4O2/c1-17(2)6-7-18(19,12-17)16(23)22-13-4-3-5-14(10-13)24-15-11-20-8-9-21-15/h3-5,8-11H,6-7,12,19H2,1-2H3,(H,22,23).
What are the key properties of 1-amino-3,3-dimethyl-N-(3-pyrazin-2-yloxyphenyl)cyclopentane-1-carboxamide?
1-amino-3,3-dimethyl-N-(3-pyrazin-2-yloxyphenyl)cyclopentane-1-carboxamide has a molecular weight of 326.40 g/mol, XLogP of 3.12, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3,3-dimethyl-N-(3-pyrazin-2-yloxyphenyl)cyclopentane-1-carboxamide is sourced from PubChem (CID 155955394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).