C15H22N6OS — CID 155955565
1-methyl-3-[(4-methyl-1,3-thiazol-2-yl)methyl]-1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)urea (PubChem CID 155955565) has the molecular formula C15H22N6OS and a molecular weight of 334.45 g/mol. Its IUPAC name is 1-methyl-3-[(4-methyl-1,3-thiazol-2-yl)methyl]-1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)urea.
| Compound Name | 1-methyl-3-[(4-methyl-1,3-thiazol-2-yl)methyl]-1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 155955565 |
| Molecular Formula | C15H22N6OS |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 1-methyl-3-[(4-methyl-1,3-thiazol-2-yl)methyl]-1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)urea |
| SMILES | Cc1csc(CNC(=O)N(C)Cc2nnc3n2CCCCC3)n1 |
| InChI | InChI=1S/C15H22N6OS/c1-11-10-23-14(17-11)8-16-15(22)20(2)9-13-19-18-12-6-4-3-5-7-21(12)13/h10H,3-9H2,1-2H3,(H,16,22) |
| InChIKey | ZFDKPGCOCSRZMN-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |