C16H21N3O2 — CID 155955584
(3aR,4R,7S,7aS)-N-(2-pyridin-4-ylethyl)-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboxamide (PubChem CID 155955584) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is (3aR,4R,7S,7aS)-N-(2-pyridin-4-ylethyl)-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboxamide.
| Compound Name | (3aR,4R,7S,7aS)-N-(2-pyridin-4-ylethyl)-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboxamide |
|---|---|
| PubChem CID | 155955584 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | (3aR,4R,7S,7aS)-N-(2-pyridin-4-ylethyl)-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboxamide |
| SMILES | O=C(NCCc1ccncc1)N1C[C@@H]2[C@H](C1)[C@H]1CC[C@@H]2O1 |
| InChI | InChI=1S/C16H21N3O2/c20-16(18-8-5-11-3-6-17-7-4-11)19-9-12-13(10-19)15-2-1-14(12)21-15/h3-4,6-7,12-15H,1-2,5,8-10H2,(H,18,20)/t12-,13+,14+,15- |
| InChIKey | AZVWLNJTCUMXRU-PYHGIMPFSA-N |
| XLogP | 1.44 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |