About 3-[[1-(3-chloro-2,6-difluorophenyl)propan-2-ylamino]methyl]-5-methyl-1H-pyridin-2-one
3-[[1-(3-chloro-2,6-difluorophenyl)propan-2-ylamino]methyl]-5-methyl-1H-pyridin-2-one (PubChem CID 155956396) has the molecular formula C16H17ClF2N2O
and a molecular weight of 326.77 g/mol. Its IUPAC name is 3-[[1-(3-chloro-2,6-difluorophenyl)propan-2-ylamino]methyl]-5-methyl-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 3-[[1-(3-chloro-2,6-difluorophenyl)propan-2-ylamino]methyl]-5-methyl-1H-pyridin-2-one |
| PubChem CID | 155956396 |
| Molecular Formula | C16H17ClF2N2O |
| Molecular Weight | 326.77 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 3-[[1-(3-chloro-2,6-difluorophenyl)propan-2-ylamino]methyl]-5-methyl-1H-pyridin-2-one |
| SMILES | Cc1c[nH]c(=O)c(CNC(C)Cc2c(F)ccc(Cl)c2F)c1 |
| InChI | InChI=1S/C16H17ClF2N2O/c1-9-5-11(16(22)21-7-9)8-20-10(2)6-12-14(18)4-3-13(17)15(12)19/h3-5,7,10,20H,6,8H2,1-2H3,(H,21,22) |
| InChIKey | NXUXIHCEHNADKN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.77 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[[1-(3-chloro-2,6-difluorophenyl)propan-2-ylamino]methyl]-5-methyl-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[1-(3-chloro-2,6-difluorophenyl)propan-2-ylamino]methyl]-5-methyl-1H-pyridin-2-one?
The IUPAC name of 3-[[1-(3-chloro-2,6-difluorophenyl)propan-2-ylamino]methyl]-5-methyl-1H-pyridin-2-one (CID 155956396) is 3-[[1-(3-chloro-2,6-difluorophenyl)propan-2-ylamino]methyl]-5-methyl-1H-pyridin-2-one.
What is the SMILES notation for 3-[[1-(3-chloro-2,6-difluorophenyl)propan-2-ylamino]methyl]-5-methyl-1H-pyridin-2-one?
The canonical SMILES for 3-[[1-(3-chloro-2,6-difluorophenyl)propan-2-ylamino]methyl]-5-methyl-1H-pyridin-2-one is Cc1c[nH]c(=O)c(CNC(C)Cc2c(F)ccc(Cl)c2F)c1.
What is the InChIKey of 3-[[1-(3-chloro-2,6-difluorophenyl)propan-2-ylamino]methyl]-5-methyl-1H-pyridin-2-one?
The InChIKey is NXUXIHCEHNADKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17ClF2N2O/c1-9-5-11(16(22)21-7-9)8-20-10(2)6-12-14(18)4-3-13(17)15(12)19/h3-5,7,10,20H,6,8H2,1-2H3,(H,21,22).
What are the key properties of 3-[[1-(3-chloro-2,6-difluorophenyl)propan-2-ylamino]methyl]-5-methyl-1H-pyridin-2-one?
3-[[1-(3-chloro-2,6-difluorophenyl)propan-2-ylamino]methyl]-5-methyl-1H-pyridin-2-one has a molecular weight of 326.77 g/mol, XLogP of 3.34, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[1-(3-chloro-2,6-difluorophenyl)propan-2-ylamino]methyl]-5-methyl-1H-pyridin-2-one is sourced from PubChem (CID 155956396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).