About 4-[4-(2,2-difluorocyclopropyl)piperidine-1-carbonyl]-1-methyl-3,4-dihydroquinolin-2-one
4-[4-(2,2-difluorocyclopropyl)piperidine-1-carbonyl]-1-methyl-3,4-dihydroquinolin-2-one (PubChem CID 155957535) has the molecular formula C19H22F2N2O2
and a molecular weight of 348.39 g/mol. Its IUPAC name is 4-[4-(2,2-difluorocyclopropyl)piperidine-1-carbonyl]-1-methyl-3,4-dihydroquinolin-2-one.
Molecular Properties
| Compound Name | 4-[4-(2,2-difluorocyclopropyl)piperidine-1-carbonyl]-1-methyl-3,4-dihydroquinolin-2-one |
| PubChem CID | 155957535 |
| Molecular Formula | C19H22F2N2O2 |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 4-[4-(2,2-difluorocyclopropyl)piperidine-1-carbonyl]-1-methyl-3,4-dihydroquinolin-2-one |
| SMILES | CN1C(=O)CC(C(=O)N2CCC(C3CC3(F)F)CC2)c2ccccc21 |
| InChI | InChI=1S/C19H22F2N2O2/c1-22-16-5-3-2-4-13(16)14(10-17(22)24)18(25)23-8-6-12(7-9-23)15-11-19(15,20)21/h2-5,12,14-15H,6-11H2,1H3 |
| InChIKey | ZYCLDCBXPSFBFI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[4-(2,2-difluorocyclopropyl)piperidine-1-carbonyl]-1-methyl-3,4-dihydroquinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(2,2-difluorocyclopropyl)piperidine-1-carbonyl]-1-methyl-3,4-dihydroquinolin-2-one?
The IUPAC name of 4-[4-(2,2-difluorocyclopropyl)piperidine-1-carbonyl]-1-methyl-3,4-dihydroquinolin-2-one (CID 155957535) is 4-[4-(2,2-difluorocyclopropyl)piperidine-1-carbonyl]-1-methyl-3,4-dihydroquinolin-2-one.
What is the SMILES notation for 4-[4-(2,2-difluorocyclopropyl)piperidine-1-carbonyl]-1-methyl-3,4-dihydroquinolin-2-one?
The canonical SMILES for 4-[4-(2,2-difluorocyclopropyl)piperidine-1-carbonyl]-1-methyl-3,4-dihydroquinolin-2-one is CN1C(=O)CC(C(=O)N2CCC(C3CC3(F)F)CC2)c2ccccc21.
What is the InChIKey of 4-[4-(2,2-difluorocyclopropyl)piperidine-1-carbonyl]-1-methyl-3,4-dihydroquinolin-2-one?
The InChIKey is ZYCLDCBXPSFBFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22F2N2O2/c1-22-16-5-3-2-4-13(16)14(10-17(22)24)18(25)23-8-6-12(7-9-23)15-11-19(15,20)21/h2-5,12,14-15H,6-11H2,1H3.
What are the key properties of 4-[4-(2,2-difluorocyclopropyl)piperidine-1-carbonyl]-1-methyl-3,4-dihydroquinolin-2-one?
4-[4-(2,2-difluorocyclopropyl)piperidine-1-carbonyl]-1-methyl-3,4-dihydroquinolin-2-one has a molecular weight of 348.39 g/mol, XLogP of 3.03, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(2,2-difluorocyclopropyl)piperidine-1-carbonyl]-1-methyl-3,4-dihydroquinolin-2-one is sourced from PubChem (CID 155957535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).