About N-(6-bromo-3,4-dihydro-1H-isothiochromen-4-yl)-2-methyl-5-oxo-1H-pyrazole-3-carboxamide
N-(6-bromo-3,4-dihydro-1H-isothiochromen-4-yl)-2-methyl-5-oxo-1H-pyrazole-3-carboxamide (PubChem CID 155959053) has the molecular formula C14H14BrN3O2S
and a molecular weight of 368.26 g/mol. Its IUPAC name is N-(6-bromo-3,4-dihydro-1H-isothiochromen-4-yl)-2-methyl-5-oxo-1H-pyrazole-3-carboxamide.
Molecular Properties
| Compound Name | N-(6-bromo-3,4-dihydro-1H-isothiochromen-4-yl)-2-methyl-5-oxo-1H-pyrazole-3-carboxamide |
| PubChem CID | 155959053 |
| Molecular Formula | C14H14BrN3O2S |
| Molecular Weight | 368.26 g/mol |
| Exact Mass | 367.00 |
| IUPAC Name | N-(6-bromo-3,4-dihydro-1H-isothiochromen-4-yl)-2-methyl-5-oxo-1H-pyrazole-3-carboxamide |
| SMILES | Cn1[nH]c(=O)cc1C(=O)NC1CSCc2ccc(Br)cc21 |
| InChI | InChI=1S/C14H14BrN3O2S/c1-18-12(5-13(19)17-18)14(20)16-11-7-21-6-8-2-3-9(15)4-10(8)11/h2-5,11H,6-7H2,1H3,(H,16,20)(H,17,19) |
| InChIKey | ZETWHGRSTOTNEP-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.26 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(6-bromo-3,4-dihydro-1H-isothiochromen-4-yl)-2-methyl-5-oxo-1H-pyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-bromo-3,4-dihydro-1H-isothiochromen-4-yl)-2-methyl-5-oxo-1H-pyrazole-3-carboxamide?
The IUPAC name of N-(6-bromo-3,4-dihydro-1H-isothiochromen-4-yl)-2-methyl-5-oxo-1H-pyrazole-3-carboxamide (CID 155959053) is N-(6-bromo-3,4-dihydro-1H-isothiochromen-4-yl)-2-methyl-5-oxo-1H-pyrazole-3-carboxamide.
What is the SMILES notation for N-(6-bromo-3,4-dihydro-1H-isothiochromen-4-yl)-2-methyl-5-oxo-1H-pyrazole-3-carboxamide?
The canonical SMILES for N-(6-bromo-3,4-dihydro-1H-isothiochromen-4-yl)-2-methyl-5-oxo-1H-pyrazole-3-carboxamide is Cn1[nH]c(=O)cc1C(=O)NC1CSCc2ccc(Br)cc21.
What is the InChIKey of N-(6-bromo-3,4-dihydro-1H-isothiochromen-4-yl)-2-methyl-5-oxo-1H-pyrazole-3-carboxamide?
The InChIKey is ZETWHGRSTOTNEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14BrN3O2S/c1-18-12(5-13(19)17-18)14(20)16-11-7-21-6-8-2-3-9(15)4-10(8)11/h2-5,11H,6-7H2,1H3,(H,16,20)(H,17,19).
What are the key properties of N-(6-bromo-3,4-dihydro-1H-isothiochromen-4-yl)-2-methyl-5-oxo-1H-pyrazole-3-carboxamide?
N-(6-bromo-3,4-dihydro-1H-isothiochromen-4-yl)-2-methyl-5-oxo-1H-pyrazole-3-carboxamide has a molecular weight of 368.26 g/mol, XLogP of 2.19, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-bromo-3,4-dihydro-1H-isothiochromen-4-yl)-2-methyl-5-oxo-1H-pyrazole-3-carboxamide is sourced from PubChem (CID 155959053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).