About 3-[4-(2,2-difluoroethoxy)piperidine-1-carbonyl]-2-methyl-1H-pyrazol-5-one
3-[4-(2,2-difluoroethoxy)piperidine-1-carbonyl]-2-methyl-1H-pyrazol-5-one (PubChem CID 155960103) has the molecular formula C12H17F2N3O3
and a molecular weight of 289.28 g/mol. Its IUPAC name is 3-[4-(2,2-difluoroethoxy)piperidine-1-carbonyl]-2-methyl-1H-pyrazol-5-one.
Molecular Properties
| Compound Name | 3-[4-(2,2-difluoroethoxy)piperidine-1-carbonyl]-2-methyl-1H-pyrazol-5-one |
| PubChem CID | 155960103 |
| Molecular Formula | C12H17F2N3O3 |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 3-[4-(2,2-difluoroethoxy)piperidine-1-carbonyl]-2-methyl-1H-pyrazol-5-one |
| SMILES | Cn1[nH]c(=O)cc1C(=O)N1CCC(OCC(F)F)CC1 |
| InChI | InChI=1S/C12H17F2N3O3/c1-16-9(6-11(18)15-16)12(19)17-4-2-8(3-5-17)20-7-10(13)14/h6,8,10H,2-5,7H2,1H3,(H,15,18) |
| InChIKey | NDTGNYGDEQLZOD-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 67.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[4-(2,2-difluoroethoxy)piperidine-1-carbonyl]-2-methyl-1H-pyrazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(2,2-difluoroethoxy)piperidine-1-carbonyl]-2-methyl-1H-pyrazol-5-one?
The IUPAC name of 3-[4-(2,2-difluoroethoxy)piperidine-1-carbonyl]-2-methyl-1H-pyrazol-5-one (CID 155960103) is 3-[4-(2,2-difluoroethoxy)piperidine-1-carbonyl]-2-methyl-1H-pyrazol-5-one.
What is the SMILES notation for 3-[4-(2,2-difluoroethoxy)piperidine-1-carbonyl]-2-methyl-1H-pyrazol-5-one?
The canonical SMILES for 3-[4-(2,2-difluoroethoxy)piperidine-1-carbonyl]-2-methyl-1H-pyrazol-5-one is Cn1[nH]c(=O)cc1C(=O)N1CCC(OCC(F)F)CC1.
What is the InChIKey of 3-[4-(2,2-difluoroethoxy)piperidine-1-carbonyl]-2-methyl-1H-pyrazol-5-one?
The InChIKey is NDTGNYGDEQLZOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17F2N3O3/c1-16-9(6-11(18)15-16)12(19)17-4-2-8(3-5-17)20-7-10(13)14/h6,8,10H,2-5,7H2,1H3,(H,15,18).
What are the key properties of 3-[4-(2,2-difluoroethoxy)piperidine-1-carbonyl]-2-methyl-1H-pyrazol-5-one?
3-[4-(2,2-difluoroethoxy)piperidine-1-carbonyl]-2-methyl-1H-pyrazol-5-one has a molecular weight of 289.28 g/mol, XLogP of 0.60, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(2,2-difluoroethoxy)piperidine-1-carbonyl]-2-methyl-1H-pyrazol-5-one is sourced from PubChem (CID 155960103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).