C19H24F3N3O4 — CID 155960172
N-ethyl-N-[2-(ethylamino)ethyl]-4-methyl-2-oxo-1H-quinoline-7-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155960172) has the molecular formula C19H24F3N3O4 and a molecular weight of 415.41 g/mol. Its IUPAC name is N-ethyl-N-[2-(ethylamino)ethyl]-4-methyl-2-oxo-1H-quinoline-7-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-ethyl-N-[2-(ethylamino)ethyl]-4-methyl-2-oxo-1H-quinoline-7-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155960172 |
| Molecular Formula | C19H24F3N3O4 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | N-ethyl-N-[2-(ethylamino)ethyl]-4-methyl-2-oxo-1H-quinoline-7-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CCNCCN(CC)C(=O)c1ccc2c(C)cc(=O)[nH]c2c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H23N3O2.C2HF3O2/c1-4-18-8-9-20(5-2)17(22)13-6-7-14-12(3)10-16(21)19-15(14)11-13;3-2(4,5)1(6)7/h6-7,10-11,18H,4-5,8-9H2,1-3H3,(H,19,21);(H,6,7) |
| InChIKey | QGADUVNKTUYHLI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 102.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|