C13H14ClN3O4S2 — CID 155960291
5-(1-chloroisoquinolin-5-yl)sulfonyl-1,2,5-thiadiazepane 1,1-dioxide (PubChem CID 155960291) has the molecular formula C13H14ClN3O4S2 and a molecular weight of 375.86 g/mol. Its IUPAC name is 5-(1-chloroisoquinolin-5-yl)sulfonyl-1,2,5-thiadiazepane 1,1-dioxide.
| Compound Name | 5-(1-chloroisoquinolin-5-yl)sulfonyl-1,2,5-thiadiazepane 1,1-dioxide |
|---|---|
| PubChem CID | 155960291 |
| Molecular Formula | C13H14ClN3O4S2 |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | 5-(1-chloroisoquinolin-5-yl)sulfonyl-1,2,5-thiadiazepane 1,1-dioxide |
| SMILES | O=S1(=O)CCN(S(=O)(=O)c2cccc3c(Cl)nccc23)CCN1 |
| InChI | InChI=1S/C13H14ClN3O4S2/c14-13-11-2-1-3-12(10(11)4-5-15-13)23(20,21)17-7-6-16-22(18,19)9-8-17/h1-5,16H,6-9H2 |
| InChIKey | LHABTDLYUIBFEI-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|