About 2-cyclobutyl-N-(2,2-difluorospiro[2.2]pentan-1-yl)-6-oxo-1H-pyrimidine-5-carboxamide
2-cyclobutyl-N-(2,2-difluorospiro[2.2]pentan-1-yl)-6-oxo-1H-pyrimidine-5-carboxamide (PubChem CID 155960636) has the molecular formula C14H15F2N3O2
and a molecular weight of 295.29 g/mol. Its IUPAC name is 2-cyclobutyl-N-(2,2-difluorospiro[2.2]pentan-1-yl)-6-oxo-1H-pyrimidine-5-carboxamide.
Molecular Properties
| Compound Name | 2-cyclobutyl-N-(2,2-difluorospiro[2.2]pentan-1-yl)-6-oxo-1H-pyrimidine-5-carboxamide |
| PubChem CID | 155960636 |
| Molecular Formula | C14H15F2N3O2 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 2-cyclobutyl-N-(2,2-difluorospiro[2.2]pentan-1-yl)-6-oxo-1H-pyrimidine-5-carboxamide |
| SMILES | O=C(NC1C(F)(F)C12CC2)c1cnc(C2CCC2)[nH]c1=O |
| InChI | InChI=1S/C14H15F2N3O2/c15-14(16)12(13(14)4-5-13)19-11(21)8-6-17-9(18-10(8)20)7-2-1-3-7/h6-7,12H,1-5H2,(H,19,21)(H,17,18,20) |
| InChIKey | HHPBOMGPJUDLQC-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclobutyl-N-(2,2-difluorospiro[2.2]pentan-1-yl)-6-oxo-1H-pyrimidine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclobutyl-N-(2,2-difluorospiro[2.2]pentan-1-yl)-6-oxo-1H-pyrimidine-5-carboxamide?
The IUPAC name of 2-cyclobutyl-N-(2,2-difluorospiro[2.2]pentan-1-yl)-6-oxo-1H-pyrimidine-5-carboxamide (CID 155960636) is 2-cyclobutyl-N-(2,2-difluorospiro[2.2]pentan-1-yl)-6-oxo-1H-pyrimidine-5-carboxamide.
What is the SMILES notation for 2-cyclobutyl-N-(2,2-difluorospiro[2.2]pentan-1-yl)-6-oxo-1H-pyrimidine-5-carboxamide?
The canonical SMILES for 2-cyclobutyl-N-(2,2-difluorospiro[2.2]pentan-1-yl)-6-oxo-1H-pyrimidine-5-carboxamide is O=C(NC1C(F)(F)C12CC2)c1cnc(C2CCC2)[nH]c1=O.
What is the InChIKey of 2-cyclobutyl-N-(2,2-difluorospiro[2.2]pentan-1-yl)-6-oxo-1H-pyrimidine-5-carboxamide?
The InChIKey is HHPBOMGPJUDLQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15F2N3O2/c15-14(16)12(13(14)4-5-13)19-11(21)8-6-17-9(18-10(8)20)7-2-1-3-7/h6-7,12H,1-5H2,(H,19,21)(H,17,18,20).
What are the key properties of 2-cyclobutyl-N-(2,2-difluorospiro[2.2]pentan-1-yl)-6-oxo-1H-pyrimidine-5-carboxamide?
2-cyclobutyl-N-(2,2-difluorospiro[2.2]pentan-1-yl)-6-oxo-1H-pyrimidine-5-carboxamide has a molecular weight of 295.29 g/mol, XLogP of 1.56, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclobutyl-N-(2,2-difluorospiro[2.2]pentan-1-yl)-6-oxo-1H-pyrimidine-5-carboxamide is sourced from PubChem (CID 155960636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).