C18H22N2O2 — CID 155961663
3-cyclopropyl-N-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)-4,5-dihydro-1,2-oxazole-5-carboxamide (PubChem CID 155961663) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 3-cyclopropyl-N-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)-4,5-dihydro-1,2-oxazole-5-carboxamide.
| Compound Name | 3-cyclopropyl-N-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)-4,5-dihydro-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 155961663 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 3-cyclopropyl-N-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)-4,5-dihydro-1,2-oxazole-5-carboxamide |
| SMILES | O=C(NCC1CCCc2ccccc21)C1CC(C2CC2)=NO1 |
| InChI | InChI=1S/C18H22N2O2/c21-18(17-10-16(20-22-17)13-8-9-13)19-11-14-6-3-5-12-4-1-2-7-15(12)14/h1-2,4,7,13-14,17H,3,5-6,8-11H2,(H,19,21) |
| InChIKey | TXJAHDVPSBYIFQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |