About (1R,4R)-1,4-dihydroxycyclopent-2-ene-1-carbonitrile
(1R,4R)-1,4-dihydroxycyclopent-2-ene-1-carbonitrile (PubChem CID 15596200) has the molecular formula C6H7NO2
and a molecular weight of 125.13 g/mol. Its IUPAC name is (1R,4R)-1,4-dihydroxycyclopent-2-ene-1-carbonitrile.
Molecular Properties
| Compound Name | (1R,4R)-1,4-dihydroxycyclopent-2-ene-1-carbonitrile |
| PubChem CID | 15596200 |
| Molecular Formula | C6H7NO2 |
| Molecular Weight | 125.13 g/mol |
| Exact Mass | 125.05 |
| IUPAC Name | (1R,4R)-1,4-dihydroxycyclopent-2-ene-1-carbonitrile |
| SMILES | N#C[C@]1(O)C=C[C@H](O)C1 |
| InChI | InChI=1S/C6H7NO2/c7-4-6(9)2-1-5(8)3-6/h1-2,5,8-9H,3H2/t5-,6-/m0/s1 |
| InChIKey | RZJKZOMFHISLIW-WDSKDSINSA-N |
| XLogP | -0.44 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.13 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1R,4R)-1,4-dihydroxycyclopent-2-ene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,4R)-1,4-dihydroxycyclopent-2-ene-1-carbonitrile?
The IUPAC name of (1R,4R)-1,4-dihydroxycyclopent-2-ene-1-carbonitrile (CID 15596200) is (1R,4R)-1,4-dihydroxycyclopent-2-ene-1-carbonitrile.
What is the SMILES notation for (1R,4R)-1,4-dihydroxycyclopent-2-ene-1-carbonitrile?
The canonical SMILES for (1R,4R)-1,4-dihydroxycyclopent-2-ene-1-carbonitrile is N#C[C@]1(O)C=C[C@H](O)C1.
What is the InChIKey of (1R,4R)-1,4-dihydroxycyclopent-2-ene-1-carbonitrile?
The InChIKey is RZJKZOMFHISLIW-WDSKDSINSA-N. The full InChI is InChI=1S/C6H7NO2/c7-4-6(9)2-1-5(8)3-6/h1-2,5,8-9H,3H2/t5-,6-/m0/s1.
What are the key properties of (1R,4R)-1,4-dihydroxycyclopent-2-ene-1-carbonitrile?
(1R,4R)-1,4-dihydroxycyclopent-2-ene-1-carbonitrile has a molecular weight of 125.13 g/mol, XLogP of -0.44, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,4R)-1,4-dihydroxycyclopent-2-ene-1-carbonitrile is sourced from PubChem (CID 15596200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).