2-[(4-chlorophenyl)methylamino]-2-(1,3-thiazol-4-yl)acetic acid

C12H11ClN2O2S — CID 155962451

IUPAC2-[(4-chlorophenyl)methylamino]-2-(1,3-thiazol-4-yl)acetic acid
SMILESO=C(O)C(NCc1ccc(Cl)cc1)c1cscn1
InChIInChI=1S/C12H11ClN2O2S/c13-9-3-1-8(2-4-9)5-14-11(12(16)17)10-6-18-7-15-10/h1-4,6-7,11,14H,5H2,(H,16,17)
InChIKeyYLBCOWUCZMSXTG-UHFFFAOYSA-N
MW282.75 g/mol
LogP2.71
Rot. Bonds5

About 2-[(4-chlorophenyl)methylamino]-2-(1,3-thiazol-4-yl)acetic acid

2-[(4-chlorophenyl)methylamino]-2-(1,3-thiazol-4-yl)acetic acid (PubChem CID 155962451) has the molecular formula C12H11ClN2O2S and a molecular weight of 282.75 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methylamino]-2-(1,3-thiazol-4-yl)acetic acid.

Molecular Properties

Compound Name2-[(4-chlorophenyl)methylamino]-2-(1,3-thiazol-4-yl)acetic acid
PubChem CID155962451
Molecular FormulaC12H11ClN2O2S
Molecular Weight282.75 g/mol
Exact Mass282.02
IUPAC Name2-[(4-chlorophenyl)methylamino]-2-(1,3-thiazol-4-yl)acetic acid
SMILESO=C(O)C(NCc1ccc(Cl)cc1)c1cscn1
InChIInChI=1S/C12H11ClN2O2S/c13-9-3-1-8(2-4-9)5-14-11(12(16)17)10-6-18-7-15-10/h1-4,6-7,11,14H,5H2,(H,16,17)
InChIKeyYLBCOWUCZMSXTG-UHFFFAOYSA-N
XLogP2.71
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500282.75
LogP ≤ 52.71
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-[(4-chlorophenyl)methylamino]-2-(1,3-thiazol-4-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(4-chlorophenyl)methylamino]-2-(1,3-thiazol-4-yl)acetic acid?
The IUPAC name of 2-[(4-chlorophenyl)methylamino]-2-(1,3-thiazol-4-yl)acetic acid (CID 155962451) is 2-[(4-chlorophenyl)methylamino]-2-(1,3-thiazol-4-yl)acetic acid.
What is the SMILES notation for 2-[(4-chlorophenyl)methylamino]-2-(1,3-thiazol-4-yl)acetic acid?
The canonical SMILES for 2-[(4-chlorophenyl)methylamino]-2-(1,3-thiazol-4-yl)acetic acid is O=C(O)C(NCc1ccc(Cl)cc1)c1cscn1.
What is the InChIKey of 2-[(4-chlorophenyl)methylamino]-2-(1,3-thiazol-4-yl)acetic acid?
The InChIKey is YLBCOWUCZMSXTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11ClN2O2S/c13-9-3-1-8(2-4-9)5-14-11(12(16)17)10-6-18-7-15-10/h1-4,6-7,11,14H,5H2,(H,16,17).
What are the key properties of 2-[(4-chlorophenyl)methylamino]-2-(1,3-thiazol-4-yl)acetic acid?
2-[(4-chlorophenyl)methylamino]-2-(1,3-thiazol-4-yl)acetic acid has a molecular weight of 282.75 g/mol, XLogP of 2.71, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-chlorophenyl)methylamino]-2-(1,3-thiazol-4-yl)acetic acid is sourced from PubChem (CID 155962451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).