About 7-chloro-4-(1,3-dimethylpyrazol-4-yl)-6-methylquinoline
7-chloro-4-(1,3-dimethylpyrazol-4-yl)-6-methylquinoline (PubChem CID 155962686) has the molecular formula C15H14ClN3
and a molecular weight of 271.75 g/mol. Its IUPAC name is 7-chloro-4-(1,3-dimethylpyrazol-4-yl)-6-methylquinoline.
Molecular Properties
| Compound Name | 7-chloro-4-(1,3-dimethylpyrazol-4-yl)-6-methylquinoline |
| PubChem CID | 155962686 |
| Molecular Formula | C15H14ClN3 |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 7-chloro-4-(1,3-dimethylpyrazol-4-yl)-6-methylquinoline |
| SMILES | Cc1cc2c(-c3cn(C)nc3C)ccnc2cc1Cl |
| InChI | InChI=1S/C15H14ClN3/c1-9-6-12-11(13-8-19(3)18-10(13)2)4-5-17-15(12)7-14(9)16/h4-8H,1-3H3 |
| InChIKey | UAFANILOSYMMPT-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-chloro-4-(1,3-dimethylpyrazol-4-yl)-6-methylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-4-(1,3-dimethylpyrazol-4-yl)-6-methylquinoline?
The IUPAC name of 7-chloro-4-(1,3-dimethylpyrazol-4-yl)-6-methylquinoline (CID 155962686) is 7-chloro-4-(1,3-dimethylpyrazol-4-yl)-6-methylquinoline.
What is the SMILES notation for 7-chloro-4-(1,3-dimethylpyrazol-4-yl)-6-methylquinoline?
The canonical SMILES for 7-chloro-4-(1,3-dimethylpyrazol-4-yl)-6-methylquinoline is Cc1cc2c(-c3cn(C)nc3C)ccnc2cc1Cl.
What is the InChIKey of 7-chloro-4-(1,3-dimethylpyrazol-4-yl)-6-methylquinoline?
The InChIKey is UAFANILOSYMMPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14ClN3/c1-9-6-12-11(13-8-19(3)18-10(13)2)4-5-17-15(12)7-14(9)16/h4-8H,1-3H3.
What are the key properties of 7-chloro-4-(1,3-dimethylpyrazol-4-yl)-6-methylquinoline?
7-chloro-4-(1,3-dimethylpyrazol-4-yl)-6-methylquinoline has a molecular weight of 271.75 g/mol, XLogP of 3.91, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-4-(1,3-dimethylpyrazol-4-yl)-6-methylquinoline is sourced from PubChem (CID 155962686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).