C20H21F3N8O — CID 155963124
(2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl)-[5-methyl-1-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]-1,2,4-triazol-3-yl]methanone (PubChem CID 155963124) has the molecular formula C20H21F3N8O and a molecular weight of 446.44 g/mol. Its IUPAC name is (2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl)-[5-methyl-1-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]-1,2,4-triazol-3-yl]methanone.
| Compound Name | (2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl)-[5-methyl-1-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]-1,2,4-triazol-3-yl]methanone |
|---|---|
| PubChem CID | 155963124 |
| Molecular Formula | C20H21F3N8O |
| Molecular Weight | 446.44 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | (2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl)-[5-methyl-1-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]-1,2,4-triazol-3-yl]methanone |
| SMILES | Cc1ccc2c(c1)C1CN(C)CCC1N2C(=O)c1nc(C)n(-c2n[nH]c(C(F)(F)F)n2)n1 |
| InChI | InChI=1S/C20H21F3N8O/c1-10-4-5-14-12(8-10)13-9-29(3)7-6-15(13)30(14)17(32)16-24-11(2)31(28-16)19-25-18(26-27-19)20(21,22)23/h4-5,8,13,15H,6-7,9H2,1-3H3,(H,25,26,27) |
| InChIKey | SZARGCAGLNRNJO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.44 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |