C22H21FKN3O4 — CID 155963517
potassium 2-[[2-fluoro-4-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamoylamino]-5-methylhex-4-enoate (PubChem CID 155963517) has the molecular formula C22H21FKN3O4 and a molecular weight of 449.52 g/mol. Its IUPAC name is potassium 2-[[2-fluoro-4-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamoylamino]-5-methylhex-4-enoate.
| Compound Name | potassium 2-[[2-fluoro-4-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamoylamino]-5-methylhex-4-enoate |
|---|---|
| PubChem CID | 155963517 |
| Molecular Formula | C22H21FKN3O4 |
| Molecular Weight | 449.52 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | potassium 2-[[2-fluoro-4-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamoylamino]-5-methylhex-4-enoate |
| SMILES | CC(C)=CCC(NC(=O)Nc1ccc(-c2nc3cc(C)ccc3o2)cc1F)C(=O)[O-].[K+] |
| InChI | InChI=1S/C22H22FN3O4.K/c1-12(2)4-7-17(21(27)28)26-22(29)25-16-8-6-14(11-15(16)23)20-24-18-10-13(3)5-9-19(18)30-20;/h4-6,8-11,17H,7H2,1-3H3,(H,27,28)(H2,25,26,29);/q;+1/p-1 |
| InChIKey | KLLWMLGFIIVIEV-UHFFFAOYSA-M |
| XLogP | 0.54 |
| TPSA | 107.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.52 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|