C10H10N6O — CID 155963709
3,5-bis(5-methyl-1H-pyrazol-3-yl)-1,2,4-oxadiazole (PubChem CID 155963709) has the molecular formula C10H10N6O and a molecular weight of 230.23 g/mol. Its IUPAC name is 3,5-bis(5-methyl-1H-pyrazol-3-yl)-1,2,4-oxadiazole.
| Compound Name | 3,5-bis(5-methyl-1H-pyrazol-3-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 155963709 |
| Molecular Formula | C10H10N6O |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 3,5-bis(5-methyl-1H-pyrazol-3-yl)-1,2,4-oxadiazole |
| SMILES | Cc1cc(-c2noc(-c3cc(C)[nH]n3)n2)n[nH]1 |
| InChI | InChI=1S/C10H10N6O/c1-5-3-7(14-12-5)9-11-10(17-16-9)8-4-6(2)13-15-8/h3-4H,1-2H3,(H,12,14)(H,13,15) |
| InChIKey | YXXAATFUXQXQCF-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |