C22H14Cl2N4O6 — CID 155964165
(3,5-dichloro-2-nitrophenyl)methyl 1-benzyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxylate (PubChem CID 155964165) has the molecular formula C22H14Cl2N4O6 and a molecular weight of 501.28 g/mol. Its IUPAC name is (3,5-dichloro-2-nitrophenyl)methyl 1-benzyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | (3,5-dichloro-2-nitrophenyl)methyl 1-benzyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 155964165 |
| Molecular Formula | C22H14Cl2N4O6 |
| Molecular Weight | 501.28 g/mol |
| Exact Mass | 500.03 |
| IUPAC Name | (3,5-dichloro-2-nitrophenyl)methyl 1-benzyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxylate |
| SMILES | O=C(OCc1cc(Cl)cc(Cl)c1[N+](=O)[O-])c1cnc2c(c1)c(=O)[nH]c(=O)n2Cc1ccccc1 |
| InChI | InChI=1S/C22H14Cl2N4O6/c23-15-6-14(18(28(32)33)17(24)8-15)11-34-21(30)13-7-16-19(25-9-13)27(22(31)26-20(16)29)10-12-4-2-1-3-5-12/h1-9H,10-11H2,(H,26,29,31) |
| InChIKey | WVAVULAESCVHFE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 137.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.28 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|