C26H36O6Si — CID 15596519
(3aS,4R,6S,7R,7aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol (PubChem CID 15596519) has the molecular formula C26H36O6Si and a molecular weight of 472.65 g/mol. Its IUPAC name is (3aS,4R,6S,7R,7aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol.
| Compound Name | (3aS,4R,6S,7R,7aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol |
|---|---|
| PubChem CID | 15596519 |
| Molecular Formula | C26H36O6Si |
| Molecular Weight | 472.65 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | (3aS,4R,6S,7R,7aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol |
| SMILES | CO[C@H]1O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]2OC(C)(C)O[C@@H]2[C@H]1O |
| InChI | InChI=1S/C26H36O6Si/c1-25(2,3)33(18-13-9-7-10-14-18,19-15-11-8-12-16-19)29-17-20-22-23(32-26(4,5)31-22)21(27)24(28-6)30-20/h7-16,20-24,27H,17H2,1-6H3/t20-,21-,22+,23-,24+/m1/s1 |
| InChIKey | HNLVRGKVSUNDEF-SJSRKZJXSA-N |
| XLogP | 2.82 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.65 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|