C29H27FN6O — CID 155966486
4-[5-[(1-cyclopentylpyrazol-3-yl)methyl]-3-[3-(phenoxymethyl)phenyl]-1,2,4-triazol-1-yl]-2-fluoropyridine (PubChem CID 155966486) has the molecular formula C29H27FN6O and a molecular weight of 494.57 g/mol. Its IUPAC name is 4-[5-[(1-cyclopentylpyrazol-3-yl)methyl]-3-[3-(phenoxymethyl)phenyl]-1,2,4-triazol-1-yl]-2-fluoropyridine.
| Compound Name | 4-[5-[(1-cyclopentylpyrazol-3-yl)methyl]-3-[3-(phenoxymethyl)phenyl]-1,2,4-triazol-1-yl]-2-fluoropyridine |
|---|---|
| PubChem CID | 155966486 |
| Molecular Formula | C29H27FN6O |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | 4-[5-[(1-cyclopentylpyrazol-3-yl)methyl]-3-[3-(phenoxymethyl)phenyl]-1,2,4-triazol-1-yl]-2-fluoropyridine |
| SMILES | Fc1cc(-n2nc(-c3cccc(COc4ccccc4)c3)nc2Cc2ccn(C3CCCC3)n2)ccn1 |
| InChI | InChI=1S/C29H27FN6O/c30-27-19-25(13-15-31-27)36-28(18-23-14-16-35(33-23)24-9-4-5-10-24)32-29(34-36)22-8-6-7-21(17-22)20-37-26-11-2-1-3-12-26/h1-3,6-8,11-17,19,24H,4-5,9-10,18,20H2 |
| InChIKey | LGSIFFCCHYUCKT-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 70.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|