About 2-N-(furan-2-ylmethyl)-2-N-methyl-4-phenylimidazo[1,5-a]pyrimidine-2,8-dicarboxamide
2-N-(furan-2-ylmethyl)-2-N-methyl-4-phenylimidazo[1,5-a]pyrimidine-2,8-dicarboxamide (PubChem CID 155967537) has the molecular formula C20H17N5O3
and a molecular weight of 375.39 g/mol. Its IUPAC name is 2-N-(furan-2-ylmethyl)-2-N-methyl-4-phenylimidazo[1,5-a]pyrimidine-2,8-dicarboxamide.
Molecular Properties
| Compound Name | 2-N-(furan-2-ylmethyl)-2-N-methyl-4-phenylimidazo[1,5-a]pyrimidine-2,8-dicarboxamide |
| PubChem CID | 155967537 |
| Molecular Formula | C20H17N5O3 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 2-N-(furan-2-ylmethyl)-2-N-methyl-4-phenylimidazo[1,5-a]pyrimidine-2,8-dicarboxamide |
| SMILES | CN(Cc1ccco1)C(=O)c1cc(-c2ccccc2)n2cnc(C(N)=O)c2n1 |
| InChI | InChI=1S/C20H17N5O3/c1-24(11-14-8-5-9-28-14)20(27)15-10-16(13-6-3-2-4-7-13)25-12-22-17(18(21)26)19(25)23-15/h2-10,12H,11H2,1H3,(H2,21,26) |
| InChIKey | QJZGEZPKHBHPIM-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 106.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-N-(furan-2-ylmethyl)-2-N-methyl-4-phenylimidazo[1,5-a]pyrimidine-2,8-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(furan-2-ylmethyl)-2-N-methyl-4-phenylimidazo[1,5-a]pyrimidine-2,8-dicarboxamide?
The IUPAC name of 2-N-(furan-2-ylmethyl)-2-N-methyl-4-phenylimidazo[1,5-a]pyrimidine-2,8-dicarboxamide (CID 155967537) is 2-N-(furan-2-ylmethyl)-2-N-methyl-4-phenylimidazo[1,5-a]pyrimidine-2,8-dicarboxamide.
What is the SMILES notation for 2-N-(furan-2-ylmethyl)-2-N-methyl-4-phenylimidazo[1,5-a]pyrimidine-2,8-dicarboxamide?
The canonical SMILES for 2-N-(furan-2-ylmethyl)-2-N-methyl-4-phenylimidazo[1,5-a]pyrimidine-2,8-dicarboxamide is CN(Cc1ccco1)C(=O)c1cc(-c2ccccc2)n2cnc(C(N)=O)c2n1.
What is the InChIKey of 2-N-(furan-2-ylmethyl)-2-N-methyl-4-phenylimidazo[1,5-a]pyrimidine-2,8-dicarboxamide?
The InChIKey is QJZGEZPKHBHPIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N5O3/c1-24(11-14-8-5-9-28-14)20(27)15-10-16(13-6-3-2-4-7-13)25-12-22-17(18(21)26)19(25)23-15/h2-10,12H,11H2,1H3,(H2,21,26).
What are the key properties of 2-N-(furan-2-ylmethyl)-2-N-methyl-4-phenylimidazo[1,5-a]pyrimidine-2,8-dicarboxamide?
2-N-(furan-2-ylmethyl)-2-N-methyl-4-phenylimidazo[1,5-a]pyrimidine-2,8-dicarboxamide has a molecular weight of 375.39 g/mol, XLogP of 2.36, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(furan-2-ylmethyl)-2-N-methyl-4-phenylimidazo[1,5-a]pyrimidine-2,8-dicarboxamide is sourced from PubChem (CID 155967537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).