C26H26N4O — CID 155967933
[3-[4-(aminomethyl)phenyl]phenyl]-[3-(1H-benzimidazol-2-yl)piperidin-1-yl]methanone (PubChem CID 155967933) has the molecular formula C26H26N4O and a molecular weight of 410.52 g/mol. Its IUPAC name is [3-[4-(aminomethyl)phenyl]phenyl]-[3-(1H-benzimidazol-2-yl)piperidin-1-yl]methanone.
| Compound Name | [3-[4-(aminomethyl)phenyl]phenyl]-[3-(1H-benzimidazol-2-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 155967933 |
| Molecular Formula | C26H26N4O |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | [3-[4-(aminomethyl)phenyl]phenyl]-[3-(1H-benzimidazol-2-yl)piperidin-1-yl]methanone |
| SMILES | NCc1ccc(-c2cccc(C(=O)N3CCCC(c4nc5ccccc5[nH]4)C3)c2)cc1 |
| InChI | InChI=1S/C26H26N4O/c27-16-18-10-12-19(13-11-18)20-5-3-6-21(15-20)26(31)30-14-4-7-22(17-30)25-28-23-8-1-2-9-24(23)29-25/h1-3,5-6,8-13,15,22H,4,7,14,16-17,27H2,(H,28,29) |
| InChIKey | WFUUNRJIXZKQFS-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |