C28H27N3O7S — CID 155968334
[1-oxo-1-[4-(propan-2-ylsulfamoyl)anilino]propan-2-yl] 4-(1,3-dioxoisoindol-2-yl)-2-methylbenzoate (PubChem CID 155968334) has the molecular formula C28H27N3O7S and a molecular weight of 549.61 g/mol. Its IUPAC name is [1-oxo-1-[4-(propan-2-ylsulfamoyl)anilino]propan-2-yl] 4-(1,3-dioxoisoindol-2-yl)-2-methylbenzoate.
| Compound Name | [1-oxo-1-[4-(propan-2-ylsulfamoyl)anilino]propan-2-yl] 4-(1,3-dioxoisoindol-2-yl)-2-methylbenzoate |
|---|---|
| PubChem CID | 155968334 |
| Molecular Formula | C28H27N3O7S |
| Molecular Weight | 549.61 g/mol |
| Exact Mass | 549.16 |
| IUPAC Name | [1-oxo-1-[4-(propan-2-ylsulfamoyl)anilino]propan-2-yl] 4-(1,3-dioxoisoindol-2-yl)-2-methylbenzoate |
| SMILES | Cc1cc(N2C(=O)c3ccccc3C2=O)ccc1C(=O)OC(C)C(=O)Nc1ccc(S(=O)(=O)NC(C)C)cc1 |
| InChI | InChI=1S/C28H27N3O7S/c1-16(2)30-39(36,37)21-12-9-19(10-13-21)29-25(32)18(4)38-28(35)22-14-11-20(15-17(22)3)31-26(33)23-7-5-6-8-24(23)27(31)34/h5-16,18,30H,1-4H3,(H,29,32) |
| InChIKey | LGSAEZQBNGCCHE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.61 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|