About potassium 2-[(4-cyclopropyl-1,3-thiazol-2-yl)carbamoylamino]-2-(2-methoxyphenyl)acetate
potassium 2-[(4-cyclopropyl-1,3-thiazol-2-yl)carbamoylamino]-2-(2-methoxyphenyl)acetate (PubChem CID 155969317) has the molecular formula C16H16KN3O4S
and a molecular weight of 385.49 g/mol. Its IUPAC name is potassium 2-[(4-cyclopropyl-1,3-thiazol-2-yl)carbamoylamino]-2-(2-methoxyphenyl)acetate.
Molecular Properties
| Compound Name | potassium 2-[(4-cyclopropyl-1,3-thiazol-2-yl)carbamoylamino]-2-(2-methoxyphenyl)acetate |
| PubChem CID | 155969317 |
| Molecular Formula | C16H16KN3O4S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | potassium 2-[(4-cyclopropyl-1,3-thiazol-2-yl)carbamoylamino]-2-(2-methoxyphenyl)acetate |
| SMILES | COc1ccccc1C(NC(=O)Nc1nc(C2CC2)cs1)C(=O)[O-].[K+] |
| InChI | InChI=1S/C16H17N3O4S.K/c1-23-12-5-3-2-4-10(12)13(14(20)21)18-15(22)19-16-17-11(8-24-16)9-6-7-9;/h2-5,8-9,13H,6-7H2,1H3,(H,20,21)(H2,17,18,19,22);/q;+1/p-1 |
| InChIKey | IUSZLTBUUYYREA-UHFFFAOYSA-M |
| XLogP | -1.35 |
| TPSA | 103.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze potassium 2-[(4-cyclopropyl-1,3-thiazol-2-yl)carbamoylamino]-2-(2-methoxyphenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 2-[(4-cyclopropyl-1,3-thiazol-2-yl)carbamoylamino]-2-(2-methoxyphenyl)acetate?
The IUPAC name of potassium 2-[(4-cyclopropyl-1,3-thiazol-2-yl)carbamoylamino]-2-(2-methoxyphenyl)acetate (CID 155969317) is potassium 2-[(4-cyclopropyl-1,3-thiazol-2-yl)carbamoylamino]-2-(2-methoxyphenyl)acetate.
What is the SMILES notation for potassium 2-[(4-cyclopropyl-1,3-thiazol-2-yl)carbamoylamino]-2-(2-methoxyphenyl)acetate?
The canonical SMILES for potassium 2-[(4-cyclopropyl-1,3-thiazol-2-yl)carbamoylamino]-2-(2-methoxyphenyl)acetate is COc1ccccc1C(NC(=O)Nc1nc(C2CC2)cs1)C(=O)[O-].[K+].
What is the InChIKey of potassium 2-[(4-cyclopropyl-1,3-thiazol-2-yl)carbamoylamino]-2-(2-methoxyphenyl)acetate?
The InChIKey is IUSZLTBUUYYREA-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H17N3O4S.K/c1-23-12-5-3-2-4-10(12)13(14(20)21)18-15(22)19-16-17-11(8-24-16)9-6-7-9;/h2-5,8-9,13H,6-7H2,1H3,(H,20,21)(H2,17,18,19,22);/q;+1/p-1.
What are the key properties of potassium 2-[(4-cyclopropyl-1,3-thiazol-2-yl)carbamoylamino]-2-(2-methoxyphenyl)acetate?
potassium 2-[(4-cyclopropyl-1,3-thiazol-2-yl)carbamoylamino]-2-(2-methoxyphenyl)acetate has a molecular weight of 385.49 g/mol, XLogP of -1.35, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 2-[(4-cyclopropyl-1,3-thiazol-2-yl)carbamoylamino]-2-(2-methoxyphenyl)acetate is sourced from PubChem (CID 155969317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).