About 2-(benzotriazol-2-yl)-4,6-dipentylphenol
2-(benzotriazol-2-yl)-4,6-dipentylphenol (PubChem CID 15596965) has the molecular formula C22H29N3O
and a molecular weight of 351.49 g/mol. Its IUPAC name is 2-(benzotriazol-2-yl)-4,6-dipentylphenol.
Molecular Properties
| Compound Name | 2-(benzotriazol-2-yl)-4,6-dipentylphenol |
| PubChem CID | 15596965 |
| Molecular Formula | C22H29N3O |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | 2-(benzotriazol-2-yl)-4,6-dipentylphenol |
| SMILES | CCCCCc1cc(CCCCC)c(O)c(-n2nc3ccccc3n2)c1 |
| InChI | InChI=1S/C22H29N3O/c1-3-5-7-11-17-15-18(12-8-6-4-2)22(26)21(16-17)25-23-19-13-9-10-14-20(19)24-25/h9-10,13-16,26H,3-8,11-12H2,1-2H3 |
| InChIKey | CYCYSJGJOIJFEP-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(benzotriazol-2-yl)-4,6-dipentylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzotriazol-2-yl)-4,6-dipentylphenol?
The IUPAC name of 2-(benzotriazol-2-yl)-4,6-dipentylphenol (CID 15596965) is 2-(benzotriazol-2-yl)-4,6-dipentylphenol.
What is the SMILES notation for 2-(benzotriazol-2-yl)-4,6-dipentylphenol?
The canonical SMILES for 2-(benzotriazol-2-yl)-4,6-dipentylphenol is CCCCCc1cc(CCCCC)c(O)c(-n2nc3ccccc3n2)c1.
What is the InChIKey of 2-(benzotriazol-2-yl)-4,6-dipentylphenol?
The InChIKey is CYCYSJGJOIJFEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29N3O/c1-3-5-7-11-17-15-18(12-8-6-4-2)22(26)21(16-17)25-23-19-13-9-10-14-20(19)24-25/h9-10,13-16,26H,3-8,11-12H2,1-2H3.
What are the key properties of 2-(benzotriazol-2-yl)-4,6-dipentylphenol?
2-(benzotriazol-2-yl)-4,6-dipentylphenol has a molecular weight of 351.49 g/mol, XLogP of 5.59, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzotriazol-2-yl)-4,6-dipentylphenol is sourced from PubChem (CID 15596965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).