About (3,3-dimethylcyclobutyl)methyl 2-cyclobutyloxy-4,6-dimethylpyridine-3-carboxylate
(3,3-dimethylcyclobutyl)methyl 2-cyclobutyloxy-4,6-dimethylpyridine-3-carboxylate (PubChem CID 155970074) has the molecular formula C19H27NO3
and a molecular weight of 317.43 g/mol. Its IUPAC name is (3,3-dimethylcyclobutyl)methyl 2-cyclobutyloxy-4,6-dimethylpyridine-3-carboxylate.
Molecular Properties
| Compound Name | (3,3-dimethylcyclobutyl)methyl 2-cyclobutyloxy-4,6-dimethylpyridine-3-carboxylate |
| PubChem CID | 155970074 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | (3,3-dimethylcyclobutyl)methyl 2-cyclobutyloxy-4,6-dimethylpyridine-3-carboxylate |
| SMILES | Cc1cc(C)c(C(=O)OCC2CC(C)(C)C2)c(OC2CCC2)n1 |
| InChI | InChI=1S/C19H27NO3/c1-12-8-13(2)20-17(23-15-6-5-7-15)16(12)18(21)22-11-14-9-19(3,4)10-14/h8,14-15H,5-7,9-11H2,1-4H3 |
| InChIKey | CAHBEMMRKYQQEC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3,3-dimethylcyclobutyl)methyl 2-cyclobutyloxy-4,6-dimethylpyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,3-dimethylcyclobutyl)methyl 2-cyclobutyloxy-4,6-dimethylpyridine-3-carboxylate?
The IUPAC name of (3,3-dimethylcyclobutyl)methyl 2-cyclobutyloxy-4,6-dimethylpyridine-3-carboxylate (CID 155970074) is (3,3-dimethylcyclobutyl)methyl 2-cyclobutyloxy-4,6-dimethylpyridine-3-carboxylate.
What is the SMILES notation for (3,3-dimethylcyclobutyl)methyl 2-cyclobutyloxy-4,6-dimethylpyridine-3-carboxylate?
The canonical SMILES for (3,3-dimethylcyclobutyl)methyl 2-cyclobutyloxy-4,6-dimethylpyridine-3-carboxylate is Cc1cc(C)c(C(=O)OCC2CC(C)(C)C2)c(OC2CCC2)n1.
What is the InChIKey of (3,3-dimethylcyclobutyl)methyl 2-cyclobutyloxy-4,6-dimethylpyridine-3-carboxylate?
The InChIKey is CAHBEMMRKYQQEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27NO3/c1-12-8-13(2)20-17(23-15-6-5-7-15)16(12)18(21)22-11-14-9-19(3,4)10-14/h8,14-15H,5-7,9-11H2,1-4H3.
What are the key properties of (3,3-dimethylcyclobutyl)methyl 2-cyclobutyloxy-4,6-dimethylpyridine-3-carboxylate?
(3,3-dimethylcyclobutyl)methyl 2-cyclobutyloxy-4,6-dimethylpyridine-3-carboxylate has a molecular weight of 317.43 g/mol, XLogP of 4.22, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3,3-dimethylcyclobutyl)methyl 2-cyclobutyloxy-4,6-dimethylpyridine-3-carboxylate is sourced from PubChem (CID 155970074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).