C11H10Cl3NO — CID 155970268
(E)-3-(dimethylamino)-1-(2,4,5-trichlorophenyl)prop-2-en-1-one (PubChem CID 155970268) has the molecular formula C11H10Cl3NO and a molecular weight of 278.57 g/mol. Its IUPAC name is (E)-3-(dimethylamino)-1-(2,4,5-trichlorophenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(dimethylamino)-1-(2,4,5-trichlorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 155970268 |
| Molecular Formula | C11H10Cl3NO |
| Molecular Weight | 278.57 g/mol |
| Exact Mass | 276.98 |
| IUPAC Name | (E)-3-(dimethylamino)-1-(2,4,5-trichlorophenyl)prop-2-en-1-one |
| SMILES | CN(C)/C=C/C(=O)c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H10Cl3NO/c1-15(2)4-3-11(16)7-5-9(13)10(14)6-8(7)12/h3-6H,1-2H3/b4-3+ |
| InChIKey | ARBUOLRDDSFGCM-ONEGZZNKSA-N |
| XLogP | 3.90 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.57 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|