About 3,7-dimethyloct-6-enyl 4-methylsulfanylbutanoate
3,7-dimethyloct-6-enyl 4-methylsulfanylbutanoate (PubChem CID 15597031) has the molecular formula C15H28O2S
and a molecular weight of 272.45 g/mol. Its IUPAC name is 3,7-dimethyloct-6-enyl 4-methylsulfanylbutanoate.
Molecular Properties
| Compound Name | 3,7-dimethyloct-6-enyl 4-methylsulfanylbutanoate |
| PubChem CID | 15597031 |
| Molecular Formula | C15H28O2S |
| Molecular Weight | 272.45 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 3,7-dimethyloct-6-enyl 4-methylsulfanylbutanoate |
| SMILES | CSCCCC(=O)OCCC(C)CCC=C(C)C |
| InChI | InChI=1S/C15H28O2S/c1-13(2)7-5-8-14(3)10-11-17-15(16)9-6-12-18-4/h7,14H,5-6,8-12H2,1-4H3 |
| InChIKey | XEWAKXMYEOGMLW-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.45 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,7-dimethyloct-6-enyl 4-methylsulfanylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dimethyloct-6-enyl 4-methylsulfanylbutanoate?
The IUPAC name of 3,7-dimethyloct-6-enyl 4-methylsulfanylbutanoate (CID 15597031) is 3,7-dimethyloct-6-enyl 4-methylsulfanylbutanoate.
What is the SMILES notation for 3,7-dimethyloct-6-enyl 4-methylsulfanylbutanoate?
The canonical SMILES for 3,7-dimethyloct-6-enyl 4-methylsulfanylbutanoate is CSCCCC(=O)OCCC(C)CCC=C(C)C.
What is the InChIKey of 3,7-dimethyloct-6-enyl 4-methylsulfanylbutanoate?
The InChIKey is XEWAKXMYEOGMLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O2S/c1-13(2)7-5-8-14(3)10-11-17-15(16)9-6-12-18-4/h7,14H,5-6,8-12H2,1-4H3.
What are the key properties of 3,7-dimethyloct-6-enyl 4-methylsulfanylbutanoate?
3,7-dimethyloct-6-enyl 4-methylsulfanylbutanoate has a molecular weight of 272.45 g/mol, XLogP of 4.45, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dimethyloct-6-enyl 4-methylsulfanylbutanoate is sourced from PubChem (CID 15597031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).