C13H18BF2NO3 — CID 155970411
6-(difluoromethoxy)-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 155970411) has the molecular formula C13H18BF2NO3 and a molecular weight of 285.10 g/mol. Its IUPAC name is 6-(difluoromethoxy)-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | 6-(difluoromethoxy)-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 155970411 |
| Molecular Formula | C13H18BF2NO3 |
| Molecular Weight | 285.10 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 6-(difluoromethoxy)-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | Cc1nc(OC(F)F)ccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C13H18BF2NO3/c1-8-9(6-7-10(17-8)18-11(15)16)14-19-12(2,3)13(4,5)20-14/h6-7,11H,1-5H3 |
| InChIKey | AZUBMWMRHZDVOJ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.10 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|