C15H14F3NO3 — CID 155971060
3-benzyl-1-(2,2,2-trifluoroethoxy)-3-azabicyclo[3.2.0]heptane-2,4-dione (PubChem CID 155971060) has the molecular formula C15H14F3NO3 and a molecular weight of 313.27 g/mol. Its IUPAC name is 3-benzyl-1-(2,2,2-trifluoroethoxy)-3-azabicyclo[3.2.0]heptane-2,4-dione.
| Compound Name | 3-benzyl-1-(2,2,2-trifluoroethoxy)-3-azabicyclo[3.2.0]heptane-2,4-dione |
|---|---|
| PubChem CID | 155971060 |
| Molecular Formula | C15H14F3NO3 |
| Molecular Weight | 313.27 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 3-benzyl-1-(2,2,2-trifluoroethoxy)-3-azabicyclo[3.2.0]heptane-2,4-dione |
| SMILES | O=C1C2CCC2(OCC(F)(F)F)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C15H14F3NO3/c16-15(17,18)9-22-14-7-6-11(14)12(20)19(13(14)21)8-10-4-2-1-3-5-10/h1-5,11H,6-9H2 |
| InChIKey | WNTSIMHXRKTDLU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.27 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|