About 3-pyrazin-2-ylpropanoic acid;hydrochloride
3-pyrazin-2-ylpropanoic acid;hydrochloride (PubChem CID 155971169) has the molecular formula C7H9ClN2O2
and a molecular weight of 188.61 g/mol. Its IUPAC name is 3-pyrazin-2-ylpropanoic acid;hydrochloride.
Molecular Properties
| Compound Name | 3-pyrazin-2-ylpropanoic acid;hydrochloride |
| PubChem CID | 155971169 |
| Molecular Formula | C7H9ClN2O2 |
| Molecular Weight | 188.61 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | 3-pyrazin-2-ylpropanoic acid;hydrochloride |
| SMILES | Cl.O=C(O)CCc1cnccn1 |
| InChI | InChI=1S/C7H8N2O2.ClH/c10-7(11)2-1-6-5-8-3-4-9-6;/h3-5H,1-2H2,(H,10,11);1H |
| InChIKey | BSPAOYXWMMAEJJ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.61 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-pyrazin-2-ylpropanoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyrazin-2-ylpropanoic acid;hydrochloride?
The IUPAC name of 3-pyrazin-2-ylpropanoic acid;hydrochloride (CID 155971169) is 3-pyrazin-2-ylpropanoic acid;hydrochloride.
What is the SMILES notation for 3-pyrazin-2-ylpropanoic acid;hydrochloride?
The canonical SMILES for 3-pyrazin-2-ylpropanoic acid;hydrochloride is Cl.O=C(O)CCc1cnccn1.
What is the InChIKey of 3-pyrazin-2-ylpropanoic acid;hydrochloride?
The InChIKey is BSPAOYXWMMAEJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O2.ClH/c10-7(11)2-1-6-5-8-3-4-9-6;/h3-5H,1-2H2,(H,10,11);1H.
What are the key properties of 3-pyrazin-2-ylpropanoic acid;hydrochloride?
3-pyrazin-2-ylpropanoic acid;hydrochloride has a molecular weight of 188.61 g/mol, XLogP of 0.92, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyrazin-2-ylpropanoic acid;hydrochloride is sourced from PubChem (CID 155971169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).