C31H37N7O6S — CID 155971632
formic acid;(10R)-22-methoxy-7-phenyl-10-propan-2-yl-14-(1,3-thiazol-4-ylmethyl)-2-oxa-5,6,8,11,14,17-hexazatricyclo[17.3.1.05,9]tricosa-1(22),6,8,19(23),20-pentaene-12,18-dione (PubChem CID 155971632) has the molecular formula C31H37N7O6S and a molecular weight of 635.75 g/mol. Its IUPAC name is formic acid;(10R)-22-methoxy-7-phenyl-10-propan-2-yl-14-(1,3-thiazol-4-ylmethyl)-2-oxa-5,6,8,11,14,17-hexazatricyclo[17.3.1.05,9]tricosa-1(22),6,8,19(23),20-pentaene-12,18-dione.
| Compound Name | formic acid;(10R)-22-methoxy-7-phenyl-10-propan-2-yl-14-(1,3-thiazol-4-ylmethyl)-2-oxa-5,6,8,11,14,17-hexazatricyclo[17.3.1.05,9]tricosa-1(22),6,8,19(23),20-pentaene-12,18-dione |
|---|---|
| PubChem CID | 155971632 |
| Molecular Formula | C31H37N7O6S |
| Molecular Weight | 635.75 g/mol |
| Exact Mass | 635.25 |
| IUPAC Name | formic acid;(10R)-22-methoxy-7-phenyl-10-propan-2-yl-14-(1,3-thiazol-4-ylmethyl)-2-oxa-5,6,8,11,14,17-hexazatricyclo[17.3.1.05,9]tricosa-1(22),6,8,19(23),20-pentaene-12,18-dione |
| SMILES | COc1ccc2cc1OCCn1nc(-c3ccccc3)nc1[C@@H](C(C)C)NC(=O)CN(Cc1cscn1)CCNC2=O.O=CO |
| InChI | InChI=1S/C30H35N7O4S.CH2O2/c1-20(2)27-29-34-28(21-7-5-4-6-8-21)35-37(29)13-14-41-25-15-22(9-10-24(25)40-3)30(39)31-11-12-36(17-26(38)33-27)16-23-18-42-19-32-23;2-1-3/h4-10,15,18-20,27H,11-14,16-17H2,1-3H3,(H,31,39)(H,33,38);1H,(H,2,3)/t27-;/m1./s1 |
| InChIKey | BCMALZFBYXITHC-HZPIKELBSA-N |
| XLogP | 3.25 |
| TPSA | 160.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.75 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|