About (2S,6R)-2-tert-butyl-4-[(2-methylpyrazol-3-yl)methyl]-6-phenylmorpholine;formic acid
(2S,6R)-2-tert-butyl-4-[(2-methylpyrazol-3-yl)methyl]-6-phenylmorpholine;formic acid (PubChem CID 155971770) has the molecular formula C20H29N3O3
and a molecular weight of 359.47 g/mol. Its IUPAC name is (2S,6R)-2-tert-butyl-4-[(2-methylpyrazol-3-yl)methyl]-6-phenylmorpholine;formic acid.
Molecular Properties
| Compound Name | (2S,6R)-2-tert-butyl-4-[(2-methylpyrazol-3-yl)methyl]-6-phenylmorpholine;formic acid |
| PubChem CID | 155971770 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | (2S,6R)-2-tert-butyl-4-[(2-methylpyrazol-3-yl)methyl]-6-phenylmorpholine;formic acid |
| SMILES | Cn1nccc1CN1C[C@@H](c2ccccc2)O[C@@H](C(C)(C)C)C1.O=CO |
| InChI | InChI=1S/C19H27N3O.CH2O2/c1-19(2,3)18-14-22(12-16-10-11-20-21(16)4)13-17(23-18)15-8-6-5-7-9-15;2-1-3/h5-11,17-18H,12-14H2,1-4H3;1H,(H,2,3)/t17-,18+;/m0./s1 |
| InChIKey | AAJLXIOBJYFTSQ-CJRXIRLBSA-N |
| XLogP | 3.11 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (2S,6R)-2-tert-butyl-4-[(2-methylpyrazol-3-yl)methyl]-6-phenylmorpholine;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,6R)-2-tert-butyl-4-[(2-methylpyrazol-3-yl)methyl]-6-phenylmorpholine;formic acid?
The IUPAC name of (2S,6R)-2-tert-butyl-4-[(2-methylpyrazol-3-yl)methyl]-6-phenylmorpholine;formic acid (CID 155971770) is (2S,6R)-2-tert-butyl-4-[(2-methylpyrazol-3-yl)methyl]-6-phenylmorpholine;formic acid.
What is the SMILES notation for (2S,6R)-2-tert-butyl-4-[(2-methylpyrazol-3-yl)methyl]-6-phenylmorpholine;formic acid?
The canonical SMILES for (2S,6R)-2-tert-butyl-4-[(2-methylpyrazol-3-yl)methyl]-6-phenylmorpholine;formic acid is Cn1nccc1CN1C[C@@H](c2ccccc2)O[C@@H](C(C)(C)C)C1.O=CO.
What is the InChIKey of (2S,6R)-2-tert-butyl-4-[(2-methylpyrazol-3-yl)methyl]-6-phenylmorpholine;formic acid?
The InChIKey is AAJLXIOBJYFTSQ-CJRXIRLBSA-N. The full InChI is InChI=1S/C19H27N3O.CH2O2/c1-19(2,3)18-14-22(12-16-10-11-20-21(16)4)13-17(23-18)15-8-6-5-7-9-15;2-1-3/h5-11,17-18H,12-14H2,1-4H3;1H,(H,2,3)/t17-,18+;/m0./s1.
What are the key properties of (2S,6R)-2-tert-butyl-4-[(2-methylpyrazol-3-yl)methyl]-6-phenylmorpholine;formic acid?
(2S,6R)-2-tert-butyl-4-[(2-methylpyrazol-3-yl)methyl]-6-phenylmorpholine;formic acid has a molecular weight of 359.47 g/mol, XLogP of 3.11, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,6R)-2-tert-butyl-4-[(2-methylpyrazol-3-yl)methyl]-6-phenylmorpholine;formic acid is sourced from PubChem (CID 155971770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).