About diethyl-(4-iminocyclohexa-2,5-dien-1-ylidene)azanium
diethyl-(4-iminocyclohexa-2,5-dien-1-ylidene)azanium (PubChem CID 15597190) has the molecular formula C10H15N2+
and a molecular weight of 163.24 g/mol. Its IUPAC name is diethyl-(4-iminocyclohexa-2,5-dien-1-ylidene)azanium.
Molecular Properties
| Compound Name | diethyl-(4-iminocyclohexa-2,5-dien-1-ylidene)azanium |
| PubChem CID | 15597190 |
| Molecular Formula | C10H15N2+ |
| Molecular Weight | 163.24 g/mol |
| Exact Mass | 163.12 |
| IUPAC Name | diethyl-(4-iminocyclohexa-2,5-dien-1-ylidene)azanium |
| SMILES | [H]N=C1C=CC(=[N+](CC)CC)C=C1 |
| InChI | InChI=1S/C10H15N2/c1-3-12(4-2)10-7-5-9(11)6-8-10/h5-8,11H,3-4H2,1-2H3/q+1 |
| InChIKey | JUDOACQYKSPSPE-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 26.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.24 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze diethyl-(4-iminocyclohexa-2,5-dien-1-ylidene)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl-(4-iminocyclohexa-2,5-dien-1-ylidene)azanium?
The IUPAC name of diethyl-(4-iminocyclohexa-2,5-dien-1-ylidene)azanium (CID 15597190) is diethyl-(4-iminocyclohexa-2,5-dien-1-ylidene)azanium.
What is the SMILES notation for diethyl-(4-iminocyclohexa-2,5-dien-1-ylidene)azanium?
The canonical SMILES for diethyl-(4-iminocyclohexa-2,5-dien-1-ylidene)azanium is [H]N=C1C=CC(=[N+](CC)CC)C=C1.
What is the InChIKey of diethyl-(4-iminocyclohexa-2,5-dien-1-ylidene)azanium?
The InChIKey is JUDOACQYKSPSPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N2/c1-3-12(4-2)10-7-5-9(11)6-8-10/h5-8,11H,3-4H2,1-2H3/q+1.
What are the key properties of diethyl-(4-iminocyclohexa-2,5-dien-1-ylidene)azanium?
diethyl-(4-iminocyclohexa-2,5-dien-1-ylidene)azanium has a molecular weight of 163.24 g/mol, XLogP of 1.63, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl-(4-iminocyclohexa-2,5-dien-1-ylidene)azanium is sourced from PubChem (CID 15597190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).