C23H27N3O3 — CID 155971972
formic acid;(3S,4R)-4-[(5-methyl-1H-pyrazol-3-yl)methyl]-1-[(2-phenylphenyl)methyl]pyrrolidin-3-ol (PubChem CID 155971972) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is formic acid;(3S,4R)-4-[(5-methyl-1H-pyrazol-3-yl)methyl]-1-[(2-phenylphenyl)methyl]pyrrolidin-3-ol.
| Compound Name | formic acid;(3S,4R)-4-[(5-methyl-1H-pyrazol-3-yl)methyl]-1-[(2-phenylphenyl)methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 155971972 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | formic acid;(3S,4R)-4-[(5-methyl-1H-pyrazol-3-yl)methyl]-1-[(2-phenylphenyl)methyl]pyrrolidin-3-ol |
| SMILES | Cc1cc(C[C@@H]2CN(Cc3ccccc3-c3ccccc3)C[C@H]2O)n[nH]1.O=CO |
| InChI | InChI=1S/C22H25N3O.CH2O2/c1-16-11-20(24-23-16)12-19-14-25(15-22(19)26)13-18-9-5-6-10-21(18)17-7-3-2-4-8-17;2-1-3/h2-11,19,22,26H,12-15H2,1H3,(H,23,24);1H,(H,2,3)/t19-,22-;/m1./s1 |
| InChIKey | RCRLHOIFUVZNSJ-JENXBZAWSA-N |
| XLogP | 3.12 |
| TPSA | 89.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|