C31H39N5O7 — CID 155972062
3,4-dimethoxy-13-[(1-methylpyrazol-4-yl)methyl]-21-oxa-10,13,17-triazatetracyclo[16.6.2.12,6.022,26]heptacosa-1(25),2,4,6(27),22(26),23-hexaene-9,16-dione;formic acid (PubChem CID 155972062) has the molecular formula C31H39N5O7 and a molecular weight of 593.68 g/mol. Its IUPAC name is 3,4-dimethoxy-13-[(1-methylpyrazol-4-yl)methyl]-21-oxa-10,13,17-triazatetracyclo[16.6.2.12,6.022,26]heptacosa-1(25),2,4,6(27),22(26),23-hexaene-9,16-dione;formic acid.
| Compound Name | 3,4-dimethoxy-13-[(1-methylpyrazol-4-yl)methyl]-21-oxa-10,13,17-triazatetracyclo[16.6.2.12,6.022,26]heptacosa-1(25),2,4,6(27),22(26),23-hexaene-9,16-dione;formic acid |
|---|---|
| PubChem CID | 155972062 |
| Molecular Formula | C31H39N5O7 |
| Molecular Weight | 593.68 g/mol |
| Exact Mass | 593.28 |
| IUPAC Name | 3,4-dimethoxy-13-[(1-methylpyrazol-4-yl)methyl]-21-oxa-10,13,17-triazatetracyclo[16.6.2.12,6.022,26]heptacosa-1(25),2,4,6(27),22(26),23-hexaene-9,16-dione;formic acid |
| SMILES | COc1cc2cc(c1OC)-c1ccc3c(c1)C(CCO3)NC(=O)CCN(Cc1cnn(C)c1)CCNC(=O)CC2.O=CO |
| InChI | InChI=1S/C30H37N5O5.CH2O2/c1-34-18-21(17-32-34)19-35-11-8-29(37)33-25-9-13-40-26-6-5-22(16-24(25)26)23-14-20(4-7-28(36)31-10-12-35)15-27(38-2)30(23)39-3;2-1-3/h5-6,14-18,25H,4,7-13,19H2,1-3H3,(H,31,36)(H,33,37);1H,(H,2,3) |
| InChIKey | LLCIADSESDDDJC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 144.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.68 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|