C16H25F3N4O5 — CID 155972135
acetic acid;methyl 2-[5-[(1S,3R,4R)-3-amino-4-methoxycyclohexyl]-1-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]acetate (PubChem CID 155972135) has the molecular formula C16H25F3N4O5 and a molecular weight of 410.39 g/mol. Its IUPAC name is acetic acid;methyl 2-[5-[(1S,3R,4R)-3-amino-4-methoxycyclohexyl]-1-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]acetate.
| Compound Name | acetic acid;methyl 2-[5-[(1S,3R,4R)-3-amino-4-methoxycyclohexyl]-1-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]acetate |
|---|---|
| PubChem CID | 155972135 |
| Molecular Formula | C16H25F3N4O5 |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | acetic acid;methyl 2-[5-[(1S,3R,4R)-3-amino-4-methoxycyclohexyl]-1-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]acetate |
| SMILES | CC(=O)O.COC(=O)Cc1nc([C@H]2CC[C@@H](OC)[C@H](N)C2)n(CC(F)(F)F)n1 |
| InChI | InChI=1S/C14H21F3N4O3.C2H4O2/c1-23-10-4-3-8(5-9(10)18)13-19-11(6-12(22)24-2)20-21(13)7-14(15,16)17;1-2(3)4/h8-10H,3-7,18H2,1-2H3;1H3,(H,3,4)/t8-,9+,10+;/m0./s1 |
| InChIKey | UFYRITBCSJZRFW-HHDYSPPTSA-N |
| XLogP | 1.26 |
| TPSA | 129.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |