C15H21Cl2N5O2 — CID 155972545
N-(3-methoxy-2-methyl-4-pyridinyl)-6,7,8,9-tetrahydro-5H-imidazo[1,2-d][1,4]diazepine-2-carboxamide;dihydrochloride (PubChem CID 155972545) has the molecular formula C15H21Cl2N5O2 and a molecular weight of 374.27 g/mol. Its IUPAC name is N-(3-methoxy-2-methyl-4-pyridinyl)-6,7,8,9-tetrahydro-5H-imidazo[1,2-d][1,4]diazepine-2-carboxamide;dihydrochloride.
| Compound Name | N-(3-methoxy-2-methyl-4-pyridinyl)-6,7,8,9-tetrahydro-5H-imidazo[1,2-d][1,4]diazepine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 155972545 |
| Molecular Formula | C15H21Cl2N5O2 |
| Molecular Weight | 374.27 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | N-(3-methoxy-2-methyl-4-pyridinyl)-6,7,8,9-tetrahydro-5H-imidazo[1,2-d][1,4]diazepine-2-carboxamide;dihydrochloride |
| SMILES | COc1c(NC(=O)c2cn3c(n2)CCNCC3)ccnc1C.Cl.Cl |
| InChI | InChI=1S/C15H19N5O2.2ClH/c1-10-14(22-2)11(3-6-17-10)19-15(21)12-9-20-8-7-16-5-4-13(20)18-12;;/h3,6,9,16H,4-5,7-8H2,1-2H3,(H,17,19,21);2*1H |
| InChIKey | SQLRLAHOSFSYPZ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.27 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |