C27H34N2O5S — CID 15597268
1-hexyl-5,7,8'-trimethoxy-3,3-dimethyl-6'-nitrospiro[indole-2,2'-thiochromene] (PubChem CID 15597268) has the molecular formula C27H34N2O5S and a molecular weight of 498.65 g/mol. Its IUPAC name is 1-hexyl-5,7,8'-trimethoxy-3,3-dimethyl-6'-nitrospiro[indole-2,2'-thiochromene].
| Compound Name | 1-hexyl-5,7,8'-trimethoxy-3,3-dimethyl-6'-nitrospiro[indole-2,2'-thiochromene] |
|---|---|
| PubChem CID | 15597268 |
| Molecular Formula | C27H34N2O5S |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | 1-hexyl-5,7,8'-trimethoxy-3,3-dimethyl-6'-nitrospiro[indole-2,2'-thiochromene] |
| SMILES | CCCCCCN1c2c(OC)cc(OC)cc2C(C)(C)C12C=Cc1cc([N+](=O)[O-])cc(OC)c1S2 |
| InChI | InChI=1S/C27H34N2O5S/c1-7-8-9-10-13-28-24-21(16-20(32-4)17-22(24)33-5)26(2,3)27(28)12-11-18-14-19(29(30)31)15-23(34-6)25(18)35-27/h11-12,14-17H,7-10,13H2,1-6H3 |
| InChIKey | UTPHLRHKDVZYIW-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 74.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|