C13H17Cl3N4 — CID 155973122
4-[4-(4-chlorophenyl)triazol-1-yl]piperidine;dihydrochloride (PubChem CID 155973122) has the molecular formula C13H17Cl3N4 and a molecular weight of 335.67 g/mol. Its IUPAC name is 4-[4-(4-chlorophenyl)triazol-1-yl]piperidine;dihydrochloride.
| Compound Name | 4-[4-(4-chlorophenyl)triazol-1-yl]piperidine;dihydrochloride |
|---|---|
| PubChem CID | 155973122 |
| Molecular Formula | C13H17Cl3N4 |
| Molecular Weight | 335.67 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | 4-[4-(4-chlorophenyl)triazol-1-yl]piperidine;dihydrochloride |
| SMILES | Cl.Cl.Clc1ccc(-c2cn(C3CCNCC3)nn2)cc1 |
| InChI | InChI=1S/C13H15ClN4.2ClH/c14-11-3-1-10(2-4-11)13-9-18(17-16-13)12-5-7-15-8-6-12;;/h1-4,9,12,15H,5-8H2;2*1H |
| InChIKey | LRKDIAIGGVQART-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.67 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |