About methyl 2-piperidin-4-yl-1,2,4-triazole-3-carboxylate
methyl 2-piperidin-4-yl-1,2,4-triazole-3-carboxylate (PubChem CID 155973262) has the molecular formula C9H14N4O2
and a molecular weight of 210.24 g/mol. Its IUPAC name is methyl 2-piperidin-4-yl-1,2,4-triazole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 2-piperidin-4-yl-1,2,4-triazole-3-carboxylate |
| PubChem CID | 155973262 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | methyl 2-piperidin-4-yl-1,2,4-triazole-3-carboxylate |
| SMILES | COC(=O)c1ncnn1C1CCNCC1 |
| InChI | InChI=1S/C9H14N4O2/c1-15-9(14)8-11-6-12-13(8)7-2-4-10-5-3-7/h6-7,10H,2-5H2,1H3 |
| InChIKey | FIMZYJRBQDAHAB-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-piperidin-4-yl-1,2,4-triazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-piperidin-4-yl-1,2,4-triazole-3-carboxylate?
The IUPAC name of methyl 2-piperidin-4-yl-1,2,4-triazole-3-carboxylate (CID 155973262) is methyl 2-piperidin-4-yl-1,2,4-triazole-3-carboxylate.
What is the SMILES notation for methyl 2-piperidin-4-yl-1,2,4-triazole-3-carboxylate?
The canonical SMILES for methyl 2-piperidin-4-yl-1,2,4-triazole-3-carboxylate is COC(=O)c1ncnn1C1CCNCC1.
What is the InChIKey of methyl 2-piperidin-4-yl-1,2,4-triazole-3-carboxylate?
The InChIKey is FIMZYJRBQDAHAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4O2/c1-15-9(14)8-11-6-12-13(8)7-2-4-10-5-3-7/h6-7,10H,2-5H2,1H3.
What are the key properties of methyl 2-piperidin-4-yl-1,2,4-triazole-3-carboxylate?
methyl 2-piperidin-4-yl-1,2,4-triazole-3-carboxylate has a molecular weight of 210.24 g/mol, XLogP of -0.01, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-piperidin-4-yl-1,2,4-triazole-3-carboxylate is sourced from PubChem (CID 155973262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).