About methyl 2-(azetidin-3-yl)-1,2,4-triazole-3-carboxylate;dihydrochloride
methyl 2-(azetidin-3-yl)-1,2,4-triazole-3-carboxylate;dihydrochloride (PubChem CID 155973264) has the molecular formula C7H12Cl2N4O2
and a molecular weight of 255.10 g/mol. Its IUPAC name is methyl 2-(azetidin-3-yl)-1,2,4-triazole-3-carboxylate;dihydrochloride.
Molecular Properties
| Compound Name | methyl 2-(azetidin-3-yl)-1,2,4-triazole-3-carboxylate;dihydrochloride |
| PubChem CID | 155973264 |
| Molecular Formula | C7H12Cl2N4O2 |
| Molecular Weight | 255.10 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | methyl 2-(azetidin-3-yl)-1,2,4-triazole-3-carboxylate;dihydrochloride |
| SMILES | COC(=O)c1ncnn1C1CNC1.Cl.Cl |
| InChI | InChI=1S/C7H10N4O2.2ClH/c1-13-7(12)6-9-4-10-11(6)5-2-8-3-5;;/h4-5,8H,2-3H2,1H3;2*1H |
| InChIKey | OOTQCVSBLGZKGE-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.10 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-(azetidin-3-yl)-1,2,4-triazole-3-carboxylate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(azetidin-3-yl)-1,2,4-triazole-3-carboxylate;dihydrochloride?
The IUPAC name of methyl 2-(azetidin-3-yl)-1,2,4-triazole-3-carboxylate;dihydrochloride (CID 155973264) is methyl 2-(azetidin-3-yl)-1,2,4-triazole-3-carboxylate;dihydrochloride.
What is the SMILES notation for methyl 2-(azetidin-3-yl)-1,2,4-triazole-3-carboxylate;dihydrochloride?
The canonical SMILES for methyl 2-(azetidin-3-yl)-1,2,4-triazole-3-carboxylate;dihydrochloride is COC(=O)c1ncnn1C1CNC1.Cl.Cl.
What is the InChIKey of methyl 2-(azetidin-3-yl)-1,2,4-triazole-3-carboxylate;dihydrochloride?
The InChIKey is OOTQCVSBLGZKGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4O2.2ClH/c1-13-7(12)6-9-4-10-11(6)5-2-8-3-5;;/h4-5,8H,2-3H2,1H3;2*1H.
What are the key properties of methyl 2-(azetidin-3-yl)-1,2,4-triazole-3-carboxylate;dihydrochloride?
methyl 2-(azetidin-3-yl)-1,2,4-triazole-3-carboxylate;dihydrochloride has a molecular weight of 255.10 g/mol, XLogP of 0.05, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(azetidin-3-yl)-1,2,4-triazole-3-carboxylate;dihydrochloride is sourced from PubChem (CID 155973264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).