6-methylidene-7H-pyrazolo[5,1-b][1,3]oxazine-3-carboxylic acid

C8H8N2O3 — CID 155973290

IUPAC6-methylidene-7H-pyrazolo[5,1-b][1,3]oxazine-3-carboxylic acid
SMILESC=C1COc2c(C(=O)O)cnn2C1
InChIInChI=1S/C8H8N2O3/c1-5-3-10-7(13-4-5)6(2-9-10)8(11)12/h2H,1,3-4H2,(H,11,12)
InChIKeyNAYOMAVPGXGHPR-UHFFFAOYSA-N
MW180.16 g/mol
LogP0.53
Rot. Bonds1

About 6-methylidene-7H-pyrazolo[5,1-b][1,3]oxazine-3-carboxylic acid

6-methylidene-7H-pyrazolo[5,1-b][1,3]oxazine-3-carboxylic acid (PubChem CID 155973290) has the molecular formula C8H8N2O3 and a molecular weight of 180.16 g/mol. Its IUPAC name is 6-methylidene-7H-pyrazolo[5,1-b][1,3]oxazine-3-carboxylic acid.

Molecular Properties

Compound Name6-methylidene-7H-pyrazolo[5,1-b][1,3]oxazine-3-carboxylic acid
PubChem CID155973290
Molecular FormulaC8H8N2O3
Molecular Weight180.16 g/mol
Exact Mass180.05
IUPAC Name6-methylidene-7H-pyrazolo[5,1-b][1,3]oxazine-3-carboxylic acid
SMILESC=C1COc2c(C(=O)O)cnn2C1
InChIInChI=1S/C8H8N2O3/c1-5-3-10-7(13-4-5)6(2-9-10)8(11)12/h2H,1,3-4H2,(H,11,12)
InChIKeyNAYOMAVPGXGHPR-UHFFFAOYSA-N
XLogP0.53
TPSA64.35 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500180.16
LogP ≤ 50.53
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 6-methylidene-7H-pyrazolo[5,1-b][1,3]oxazine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-methylidene-7H-pyrazolo[5,1-b][1,3]oxazine-3-carboxylic acid?
The IUPAC name of 6-methylidene-7H-pyrazolo[5,1-b][1,3]oxazine-3-carboxylic acid (CID 155973290) is 6-methylidene-7H-pyrazolo[5,1-b][1,3]oxazine-3-carboxylic acid.
What is the SMILES notation for 6-methylidene-7H-pyrazolo[5,1-b][1,3]oxazine-3-carboxylic acid?
The canonical SMILES for 6-methylidene-7H-pyrazolo[5,1-b][1,3]oxazine-3-carboxylic acid is C=C1COc2c(C(=O)O)cnn2C1.
What is the InChIKey of 6-methylidene-7H-pyrazolo[5,1-b][1,3]oxazine-3-carboxylic acid?
The InChIKey is NAYOMAVPGXGHPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O3/c1-5-3-10-7(13-4-5)6(2-9-10)8(11)12/h2H,1,3-4H2,(H,11,12).
What are the key properties of 6-methylidene-7H-pyrazolo[5,1-b][1,3]oxazine-3-carboxylic acid?
6-methylidene-7H-pyrazolo[5,1-b][1,3]oxazine-3-carboxylic acid has a molecular weight of 180.16 g/mol, XLogP of 0.53, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylidene-7H-pyrazolo[5,1-b][1,3]oxazine-3-carboxylic acid is sourced from PubChem (CID 155973290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).