C10H15ClN2O — CID 155973359
2-(4-aminophenyl)-2-methylpropanamide;hydrochloride (PubChem CID 155973359) has the molecular formula C10H15ClN2O and a molecular weight of 214.70 g/mol. Its IUPAC name is 2-(4-aminophenyl)-2-methylpropanamide;hydrochloride.
| Compound Name | 2-(4-aminophenyl)-2-methylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 155973359 |
| Molecular Formula | C10H15ClN2O |
| Molecular Weight | 214.70 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 2-(4-aminophenyl)-2-methylpropanamide;hydrochloride |
| SMILES | CC(C)(C(N)=O)c1ccc(N)cc1.Cl |
| InChI | InChI=1S/C10H14N2O.ClH/c1-10(2,9(12)13)7-3-5-8(11)6-4-7;/h3-6H,11H2,1-2H3,(H2,12,13);1H |
| InChIKey | VODVDARCXXNEEA-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.70 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|