C10H16BNO2 — CID 155973440
2-(1-isocyanocyclopropyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 155973440) has the molecular formula C10H16BNO2 and a molecular weight of 193.06 g/mol. Its IUPAC name is 2-(1-isocyanocyclopropyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(1-isocyanocyclopropyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 155973440 |
| Molecular Formula | C10H16BNO2 |
| Molecular Weight | 193.06 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | 2-(1-isocyanocyclopropyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | [C-]#[N+]C1(B2OC(C)(C)C(C)(C)O2)CC1 |
| InChI | InChI=1S/C10H16BNO2/c1-8(2)9(3,4)14-11(13-8)10(12-5)6-7-10/h6-7H2,1-4H3 |
| InChIKey | AMQSNSZXSIEFIN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 22.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.06 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|