About N,N-dimethyl-7-azaspiro[3.5]nonan-2-amine;dihydrochloride
N,N-dimethyl-7-azaspiro[3.5]nonan-2-amine;dihydrochloride (PubChem CID 155973577) has the molecular formula C10H22Cl2N2
and a molecular weight of 241.21 g/mol. Its IUPAC name is N,N-dimethyl-7-azaspiro[3.5]nonan-2-amine;dihydrochloride.
Molecular Properties
| Compound Name | N,N-dimethyl-7-azaspiro[3.5]nonan-2-amine;dihydrochloride |
| PubChem CID | 155973577 |
| Molecular Formula | C10H22Cl2N2 |
| Molecular Weight | 241.21 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | N,N-dimethyl-7-azaspiro[3.5]nonan-2-amine;dihydrochloride |
| SMILES | CN(C)C1CC2(CCNCC2)C1.Cl.Cl |
| InChI | InChI=1S/C10H20N2.2ClH/c1-12(2)9-7-10(8-9)3-5-11-6-4-10;;/h9,11H,3-8H2,1-2H3;2*1H |
| InChIKey | ARCGDRQLOHTKFG-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.21 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-dimethyl-7-azaspiro[3.5]nonan-2-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-7-azaspiro[3.5]nonan-2-amine;dihydrochloride?
The IUPAC name of N,N-dimethyl-7-azaspiro[3.5]nonan-2-amine;dihydrochloride (CID 155973577) is N,N-dimethyl-7-azaspiro[3.5]nonan-2-amine;dihydrochloride.
What is the SMILES notation for N,N-dimethyl-7-azaspiro[3.5]nonan-2-amine;dihydrochloride?
The canonical SMILES for N,N-dimethyl-7-azaspiro[3.5]nonan-2-amine;dihydrochloride is CN(C)C1CC2(CCNCC2)C1.Cl.Cl.
What is the InChIKey of N,N-dimethyl-7-azaspiro[3.5]nonan-2-amine;dihydrochloride?
The InChIKey is ARCGDRQLOHTKFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2.2ClH/c1-12(2)9-7-10(8-9)3-5-11-6-4-10;;/h9,11H,3-8H2,1-2H3;2*1H.
What are the key properties of N,N-dimethyl-7-azaspiro[3.5]nonan-2-amine;dihydrochloride?
N,N-dimethyl-7-azaspiro[3.5]nonan-2-amine;dihydrochloride has a molecular weight of 241.21 g/mol, XLogP of 1.92, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-7-azaspiro[3.5]nonan-2-amine;dihydrochloride is sourced from PubChem (CID 155973577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).