2-(1,1-difluoroethyl)-1,3-thiazole-5-sulfonyl chloride

C5H4ClF2NO2S2 — CID 155973595

IUPAC2-(1,1-difluoroethyl)-1,3-thiazole-5-sulfonyl chloride
SMILESCC(F)(F)c1ncc(S(=O)(=O)Cl)s1
InChIInChI=1S/C5H4ClF2NO2S2/c1-5(7,8)4-9-2-3(12-4)13(6,10)11/h2H,1H3
InChIKeyZRRLDQZANCLPJV-UHFFFAOYSA-N
MW247.68 g/mol
LogP2.18
Rot. Bonds2

About 2-(1,1-difluoroethyl)-1,3-thiazole-5-sulfonyl chloride

2-(1,1-difluoroethyl)-1,3-thiazole-5-sulfonyl chloride (PubChem CID 155973595) has the molecular formula C5H4ClF2NO2S2 and a molecular weight of 247.68 g/mol. Its IUPAC name is 2-(1,1-difluoroethyl)-1,3-thiazole-5-sulfonyl chloride.

Molecular Properties

Compound Name2-(1,1-difluoroethyl)-1,3-thiazole-5-sulfonyl chloride
PubChem CID155973595
Molecular FormulaC5H4ClF2NO2S2
Molecular Weight247.68 g/mol
Exact Mass246.93
IUPAC Name2-(1,1-difluoroethyl)-1,3-thiazole-5-sulfonyl chloride
SMILESCC(F)(F)c1ncc(S(=O)(=O)Cl)s1
InChIInChI=1S/C5H4ClF2NO2S2/c1-5(7,8)4-9-2-3(12-4)13(6,10)11/h2H,1H3
InChIKeyZRRLDQZANCLPJV-UHFFFAOYSA-N
XLogP2.18
TPSA47.03 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500247.68
LogP ≤ 52.18
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze 2-(1,1-difluoroethyl)-1,3-thiazole-5-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,1-difluoroethyl)-1,3-thiazole-5-sulfonyl chloride?
The IUPAC name of 2-(1,1-difluoroethyl)-1,3-thiazole-5-sulfonyl chloride (CID 155973595) is 2-(1,1-difluoroethyl)-1,3-thiazole-5-sulfonyl chloride.
What is the SMILES notation for 2-(1,1-difluoroethyl)-1,3-thiazole-5-sulfonyl chloride?
The canonical SMILES for 2-(1,1-difluoroethyl)-1,3-thiazole-5-sulfonyl chloride is CC(F)(F)c1ncc(S(=O)(=O)Cl)s1.
What is the InChIKey of 2-(1,1-difluoroethyl)-1,3-thiazole-5-sulfonyl chloride?
The InChIKey is ZRRLDQZANCLPJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4ClF2NO2S2/c1-5(7,8)4-9-2-3(12-4)13(6,10)11/h2H,1H3.
What are the key properties of 2-(1,1-difluoroethyl)-1,3-thiazole-5-sulfonyl chloride?
2-(1,1-difluoroethyl)-1,3-thiazole-5-sulfonyl chloride has a molecular weight of 247.68 g/mol, XLogP of 2.18, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-difluoroethyl)-1,3-thiazole-5-sulfonyl chloride is sourced from PubChem (CID 155973595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).