About 7-iodopyrazolo[1,5-a]pyrazin-4-amine
7-iodopyrazolo[1,5-a]pyrazin-4-amine (PubChem CID 155973699) has the molecular formula C6H5IN4
and a molecular weight of 260.04 g/mol. Its IUPAC name is 7-iodopyrazolo[1,5-a]pyrazin-4-amine.
Molecular Properties
| Compound Name | 7-iodopyrazolo[1,5-a]pyrazin-4-amine |
| PubChem CID | 155973699 |
| Molecular Formula | C6H5IN4 |
| Molecular Weight | 260.04 g/mol |
| Exact Mass | 259.96 |
| IUPAC Name | 7-iodopyrazolo[1,5-a]pyrazin-4-amine |
| SMILES | Nc1ncc(I)n2nccc12 |
| InChI | InChI=1S/C6H5IN4/c7-5-3-9-6(8)4-1-2-10-11(4)5/h1-3H,(H2,8,9) |
| InChIKey | PSNGBUMCRSWJGB-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.04 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 7-iodopyrazolo[1,5-a]pyrazin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-iodopyrazolo[1,5-a]pyrazin-4-amine?
The IUPAC name of 7-iodopyrazolo[1,5-a]pyrazin-4-amine (CID 155973699) is 7-iodopyrazolo[1,5-a]pyrazin-4-amine.
What is the SMILES notation for 7-iodopyrazolo[1,5-a]pyrazin-4-amine?
The canonical SMILES for 7-iodopyrazolo[1,5-a]pyrazin-4-amine is Nc1ncc(I)n2nccc12.
What is the InChIKey of 7-iodopyrazolo[1,5-a]pyrazin-4-amine?
The InChIKey is PSNGBUMCRSWJGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5IN4/c7-5-3-9-6(8)4-1-2-10-11(4)5/h1-3H,(H2,8,9).
What are the key properties of 7-iodopyrazolo[1,5-a]pyrazin-4-amine?
7-iodopyrazolo[1,5-a]pyrazin-4-amine has a molecular weight of 260.04 g/mol, XLogP of 0.92, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-iodopyrazolo[1,5-a]pyrazin-4-amine is sourced from PubChem (CID 155973699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).